The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(4-(4-fluorophenyl)piperazin-1-yl)propyl)-7-methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-sulfonamide ID: ALA3397388
PubChem CID: 118726647
Max Phase: Preclinical
Molecular Formula: C22H27FN4O4S
Molecular Weight: 462.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c(cc1S(=O)(=O)NCCCN1CCN(c3ccc(F)cc3)CC1)NC(=O)CO2
Standard InChI: InChI=1S/C22H27FN4O4S/c1-16-13-20-19(25-22(28)15-31-20)14-21(16)32(29,30)24-7-2-8-26-9-11-27(12-10-26)18-5-3-17(23)4-6-18/h3-6,13-14,24H,2,7-12,15H2,1H3,(H,25,28)
Standard InChI Key: JNONYPDHNFILRK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2097 9.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5076 10.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8078 9.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8100 8.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5122 7.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2120 8.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5114 6.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 5.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2110 3.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5053 12.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2063 12.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2064 14.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5054 15.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8044 14.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8044 12.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5055 16.2038 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 2 1 0
2 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 2 0
17 25 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
5 26 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.1737AlogP: 1.96#Rotatable Bonds: 7Polar Surface Area: 90.98Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.45CX Basic pKa: 7.10CX LogP: 2.06CX LogD: 1.88Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.91
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]