The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-methyl-4-(2-oxo-2-phenylethyl)-6-((4-(4-(trifluoromethyl)phenyl)piperazin-1-yl)sulfonyl)-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3397391
PubChem CID: 118726650
Max Phase: Preclinical
Molecular Formula: C28H26F3N3O5S
Molecular Weight: 573.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c(cc1S(=O)(=O)N1CCN(c3ccc(C(F)(F)F)cc3)CC1)N(CC(=O)c1ccccc1)C(=O)CO2
Standard InChI: InChI=1S/C28H26F3N3O5S/c1-19-15-25-23(34(27(36)18-39-25)17-24(35)20-5-3-2-4-6-20)16-26(19)40(37,38)33-13-11-32(12-14-33)22-9-7-21(8-10-22)28(29,30)31/h2-10,15-16H,11-14,17-18H2,1H3
Standard InChI Key: JWSQEZPWCZEAOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2108 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2115 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9129 6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6135 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6127 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9136 7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2102 9.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9104 10.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6121 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6138 8.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9087 12.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9469 12.6035 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8687 12.6003 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9069 13.2018 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
8 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
4 21 1 0
4 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
19 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.59Molecular Weight (Monoisotopic): 573.1545AlogP: 4.13#Rotatable Bonds: 6Polar Surface Area: 87.23Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.90CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.41Np Likeness Score: -1.73
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]