The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((4-(2-methoxyphenyl)piperazin-1-yl)sulfonyl)-7-methyl-4-(2-oxo-2-phenylethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3397456
PubChem CID: 118726695
Max Phase: Preclinical
Molecular Formula: C28H29N3O6S
Molecular Weight: 535.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(S(=O)(=O)c2cc3c(cc2C)OCC(=O)N3CC(=O)c2ccccc2)CC1
Standard InChI: InChI=1S/C28H29N3O6S/c1-20-16-26-23(31(28(33)19-37-26)18-24(32)21-8-4-3-5-9-21)17-27(20)38(34,35)30-14-12-29(13-15-30)22-10-6-7-11-25(22)36-2/h3-11,16-17H,12-15,18-19H2,1-2H3
Standard InChI Key: YISATXZWWMUIIL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2108 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2115 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9129 6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6135 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6127 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9136 7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2102 9.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9104 10.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6121 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6138 8.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5140 7.5061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5517 8.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
8 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
4 21 1 0
4 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
32 33 1 0
19 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.62Molecular Weight (Monoisotopic): 535.1777AlogP: 3.12#Rotatable Bonds: 7Polar Surface Area: 96.46Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.36CX LogP: 3.00CX LogD: 3.00Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: -1.55
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]