The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((4-(2-methoxyphenyl)piperazin-1-yl)sulfonyl)-7-methyl-4-(2-(4-nitrophenyl)-2-oxoethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3397458
PubChem CID: 118726697
Max Phase: Preclinical
Molecular Formula: C28H28N4O8S
Molecular Weight: 580.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(S(=O)(=O)c2cc3c(cc2C)OCC(=O)N3CC(=O)c2ccc([N+](=O)[O-])cc2)CC1
Standard InChI: InChI=1S/C28H28N4O8S/c1-19-15-26-23(31(28(34)18-40-26)17-24(33)20-7-9-21(10-8-20)32(35)36)16-27(19)41(37,38)30-13-11-29(12-14-30)22-5-3-4-6-25(22)39-2/h3-10,15-16H,11-14,17-18H2,1-2H3
Standard InChI Key: YUXWSOAYMSEVON-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2108 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2115 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9129 6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6135 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6127 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9136 7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2102 9.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9104 10.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6121 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6138 8.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5140 7.5061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5517 8.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 9.7484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5603 10.3470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6386 10.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
8 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
4 21 1 0
4 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
32 33 1 0
19 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 19 1 0
39 40 2 0
39 41 1 0
36 39 1 0
M CHG 2 39 1 41 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 580.62Molecular Weight (Monoisotopic): 580.1628AlogP: 3.03#Rotatable Bonds: 8Polar Surface Area: 139.60Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.36CX LogP: 2.94CX LogD: 2.94Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: -1.72
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]