The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(4-methoxyphenyl)-2-oxoethyl)-6-((4-(2-methoxyphenyl)piperazin-1-yl)sulfonyl)-7-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3397459
PubChem CID: 118726698
Max Phase: Preclinical
Molecular Formula: C29H31N3O7S
Molecular Weight: 565.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)CN2C(=O)COc3cc(C)c(S(=O)(=O)N4CCN(c5ccccc5OC)CC4)cc32)cc1
Standard InChI: InChI=1S/C29H31N3O7S/c1-20-16-27-24(32(29(34)19-39-27)18-25(33)21-8-10-22(37-2)11-9-21)17-28(20)40(35,36)31-14-12-30(13-15-31)23-6-4-5-7-26(23)38-3/h4-11,16-17H,12-15,18-19H2,1-3H3
Standard InChI Key: LTRYDOLMPUHVMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2108 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2115 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9129 6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6135 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6127 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9136 7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2102 9.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9104 10.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6121 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6138 8.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5140 7.5061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5517 8.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 9.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5603 10.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
8 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
4 21 1 0
4 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
32 33 1 0
19 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 19 1 0
36 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.65Molecular Weight (Monoisotopic): 565.1883AlogP: 3.13#Rotatable Bonds: 8Polar Surface Area: 105.69Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.36CX LogP: 2.84CX LogD: 2.84Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: -1.52
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]