The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((4-(2-methoxyphenyl)piperazin-1-yl)sulfonyl)-7-methyl-4-(2-oxo-2-(thiophen-2-yl)ethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one ID: ALA3397461
PubChem CID: 118726700
Max Phase: Preclinical
Molecular Formula: C26H27N3O6S2
Molecular Weight: 541.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(S(=O)(=O)c2cc3c(cc2C)OCC(=O)N3CC(=O)c2cccs2)CC1
Standard InChI: InChI=1S/C26H27N3O6S2/c1-18-14-23-20(29(26(31)17-35-23)16-21(30)24-8-5-13-36-24)15-25(18)37(32,33)28-11-9-27(10-12-28)19-6-3-4-7-22(19)34-2/h3-8,13-15H,9-12,16-17H2,1-2H3
Standard InChI Key: DWQNENXLRPFVKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-4.9497 0.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9106 1.4992 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9500 2.0989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9114 3.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2108 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2115 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9129 6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6135 5.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6127 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9136 7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2118 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2102 9.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9104 10.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6121 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6138 8.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5140 7.5061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5517 8.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8169 6.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3534 7.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8534 7.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3899 6.1074 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
8 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
4 21 1 0
4 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
32 33 1 0
19 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.65Molecular Weight (Monoisotopic): 541.1341AlogP: 3.18#Rotatable Bonds: 7Polar Surface Area: 96.46Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.36CX LogP: 2.91CX LogD: 2.91Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.93
References 1. Konda S, Raparthi S, Bhaskar K, Munaganti RK, Guguloth V, Nagarapu L, Akkewar DM.. (2015) Synthesis and antimicrobial activity of novel benzoxazine sulfonamide derivatives., 25 (7): [PMID:25754493 ] [10.1016/j.bmcl.2015.01.026 ]