The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propyl 2-(4-(3,3,3-trifluoro-2,2-dimethylpropanoyloxy)benzamido)benzoate ID: ALA3398159
PubChem CID: 118727255
Max Phase: Preclinical
Molecular Formula: C22H22F3NO5
Molecular Weight: 437.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCOC(=O)c1ccccc1NC(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
Standard InChI: InChI=1S/C22H22F3NO5/c1-4-13-30-19(28)16-7-5-6-8-17(16)26-18(27)14-9-11-15(12-10-14)31-20(29)21(2,3)22(23,24)25/h5-12H,4,13H2,1-3H3,(H,26,27)
Standard InChI Key: JROXMUKXHVGXGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
10.3947 7.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3927 6.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3546 6.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 6.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4914 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 3.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7927 6.0049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0914 5.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6914 5.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0894 4.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7318 5.8461 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7295 4.6463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6893 4.0482 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -5.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 11 2 0
4 12 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
13 20 2 0
13 21 1 0
23 2 1 0
2 24 1 0
23 25 2 0
22 23 1 0
17 22 1 0
6 21 1 0
12 26 1 0
24 27 1 0
24 28 1 0
24 29 1 0
26 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.41Molecular Weight (Monoisotopic): 437.1450AlogP: 5.00#Rotatable Bonds: 7Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.37CX LogD: 6.37Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.89
References 1. Hwang TL, Wang WH, Wang TY, Yu HP, Hsieh PW.. (2015) Synthesis and pharmacological characterization of 2-aminobenzaldehyde oxime analogs as dual inhibitors of neutrophil elastase and proteinase 3., 23 (5): [PMID:25650311 ] [10.1016/j.bmc.2014.12.056 ]