The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(4-(3,3,3-trifluoro-2,2-dimethylpropanoyloxy)phenylsulfonamide)benzoate ID: ALA3398160
PubChem CID: 118727256
Max Phase: Preclinical
Molecular Formula: C19H18F3NO6S
Molecular Weight: 445.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(=O)C(C)(C)C(F)(F)F)cc1
Standard InChI: InChI=1S/C19H18F3NO6S/c1-18(2,19(20,21)22)17(25)29-12-8-10-13(11-9-12)30(26,27)23-15-7-5-4-6-14(15)16(24)28-3/h4-11,23H,1-3H3
Standard InChI Key: VFYZSCJFFKGKCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
1.5548 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5568 2.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1178 7.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0763 8.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0811 7.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1939 3.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4914 3.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4883 5.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 6.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8902 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7849 6.0182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7797 7.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0711 9.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7382 8.1150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1078 10.3798 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0663 10.9755 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0296 10.3716 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
7 14 2 0
7 15 1 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
2 22 1 0
24 5 1 0
5 25 1 0
24 26 2 0
23 24 1 0
19 23 1 0
9 22 1 0
15 27 1 0
25 28 1 0
25 29 1 0
25 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.42Molecular Weight (Monoisotopic): 445.0807AlogP: 3.77#Rotatable Bonds: 6Polar Surface Area: 98.77Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.15CX Basic pKa: ┄CX LogP: 4.24CX LogD: 3.87Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.08
References 1. Hwang TL, Wang WH, Wang TY, Yu HP, Hsieh PW.. (2015) Synthesis and pharmacological characterization of 2-aminobenzaldehyde oxime analogs as dual inhibitors of neutrophil elastase and proteinase 3., 23 (5): [PMID:25650311 ] [10.1016/j.bmc.2014.12.056 ]