The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2RS)-2-Hydroxy-[(2RS)-1-{2-[tris(4-methoxyphenyl)methoxy]-ethyl}-pyrrolidine-2-yl]aceticacid ID: ALA3398502
PubChem CID: 118727505
Max Phase: Preclinical
Molecular Formula: C30H35NO7
Molecular Weight: 521.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(OCCN2CCC[C@@H]2[C@@H](O)C(=O)O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C30H35NO7/c1-35-24-12-6-21(7-13-24)30(22-8-14-25(36-2)15-9-22,23-10-16-26(37-3)17-11-23)38-20-19-31-18-4-5-27(31)28(32)29(33)34/h6-17,27-28,32H,4-5,18-20H2,1-3H3,(H,33,34)/t27-,28-/m1/s1
Standard InChI Key: PONNCRQNJCYCMA-VSGBNLITSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
1.6341 -1.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1211 0.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3561 0.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3203 -0.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8073 -2.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6699 -2.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5992 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8985 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8989 2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6001 3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3009 2.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3004 0.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6814 -9.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6992 -8.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2905 -8.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3650 -7.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2091 -6.5310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6442 -6.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4709 -10.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6703 -10.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9033 -11.4107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8518 -6.8972 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5180 -9.1137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6962 -5.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6606 -3.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1477 -2.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1121 -1.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5900 -1.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1031 -3.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5803 -3.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5444 -2.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0314 -0.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -0.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0230 -2.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7930 -1.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7989 -0.3709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5689 -1.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5975 4.5013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5576 5.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
16 13 1 0
13 19 1 0
19 20 1 0
19 21 2 0
16 22 1 1
13 23 1 6
17 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 7 1 0
27 28 1 0
27 1 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
4 36 1 0
36 37 1 0
10 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.61Molecular Weight (Monoisotopic): 521.2414AlogP: 3.93#Rotatable Bonds: 12Polar Surface Area: 97.69Molecular Species: ZWITTERIONHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.60CX Basic pKa: 9.02CX LogP: 1.56CX LogD: 1.55Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: 0.06
References 1. Steffan T, Renukappa-Gutke T, Höfner G, Wanner KT.. (2015) Design, synthesis and SAR studies of GABA uptake inhibitors derived from 2-substituted pyrrolidine-2-yl-acetic acids., 23 (6): [PMID:25698617 ] [10.1016/j.bmc.2015.01.035 ]