The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxy-5-phenylpent-1-en-1-yl)-5-oxocyclopentyl)-N-(2-hydroxyethyl)hept-5-enamide ID: ALA3398545
PubChem CID: 118727545
Max Phase: Preclinical
Molecular Formula: C25H35NO5
Molecular Weight: 429.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCc1ccccc1)NCCO
Standard InChI: InChI=1S/C25H35NO5/c27-17-16-26-25(31)11-7-2-1-6-10-21-22(24(30)18-23(21)29)15-14-20(28)13-12-19-8-4-3-5-9-19/h1,3-6,8-9,14-15,20-22,24,27-28,30H,2,7,10-13,16-18H2,(H,26,31)/b6-1-,15-14+/t20-,21+,22+,24+/m0/s1
Standard InChI Key: UNRIGVDTQLYALV-JFZJXZSWSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
3.9707 -8.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3978 -8.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9293 -9.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4293 -9.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6313 -10.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8197 -7.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8330 -7.9858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1234 -6.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5478 -5.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6701 -6.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0945 -6.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2168 -7.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6412 -7.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7635 -8.0051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8829 -5.8332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1879 -7.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3102 -8.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4491 -8.1508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 2 0
3 7 1 1
1 8 1 1
2 9 1 6
9 10 2 0
7 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
10 22 1 0
22 23 1 0
22 24 1 6
23 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.56Molecular Weight (Monoisotopic): 429.2515AlogP: 2.33#Rotatable Bonds: 13Polar Surface Area: 106.86Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.20CX LogD: 2.20Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: 1.19
References 1. Finnegan DF, Shelnut EL, Nikas SP, Chiang N, Serhan CN, Makriyannis A.. (2015) Novel tail and head group prostamide probes., 25 (6): [PMID:25701254 ] [10.1016/j.bmcl.2015.01.064 ]