The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{1-((R)-Hydroxymethyl)-3-[6-(3-pyridin-3-yl-propionylamino)-indol-1-yl]-propyl}-1H-imidazole-4-carboxylic acid amide ID: ALA340086
PubChem CID: 11453636
Max Phase: Preclinical
Molecular Formula: C24H26N6O3
Molecular Weight: 446.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1cn([C@@H](CO)CCn2ccc3ccc(NC(=O)CCc4cccnc4)cc32)cn1
Standard InChI: InChI=1S/C24H26N6O3/c25-24(33)21-14-30(16-27-21)20(15-31)8-11-29-10-7-18-4-5-19(12-22(18)29)28-23(32)6-3-17-2-1-9-26-13-17/h1-2,4-5,7,9-10,12-14,16,20,31H,3,6,8,11,15H2,(H2,25,33)(H,28,32)/t20-/m1/s1
Standard InChI Key: YBDWQONQIHCMPV-HXUWFJFHSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
2.0167 0.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8292 0.9083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -0.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 -0.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8417 -2.0750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2375 0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0292 -1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4042 1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9250 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3833 -1.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3833 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -0.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4542 -1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2417 -1.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2083 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 1.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0500 -3.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8500 0.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2083 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5792 2.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 -1.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6208 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6833 -1.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0958 -1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6583 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -0.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8750 -3.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -1.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9125 -1.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3083 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 1 2 0
5 15 1 0
6 2 2 0
7 5 1 0
8 1 1 0
9 5 1 0
10 9 2 0
11 7 2 0
12 7 1 0
13 14 1 0
14 17 1 0
15 16 1 0
16 18 1 0
17 11 1 0
18 3 1 1
19 8 2 0
20 28 2 0
21 13 2 0
22 12 2 0
23 8 1 0
24 13 1 0
25 22 1 0
26 24 1 0
27 26 1 0
28 27 1 0
29 31 1 0
30 33 2 0
31 18 1 0
32 27 2 0
33 32 1 0
3 6 1 0
12 10 1 0
17 25 2 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.2066AlogP: 2.53#Rotatable Bonds: 10Polar Surface Area: 128.06Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.50CX Basic pKa: 4.94CX LogP: 1.17CX LogD: 1.17Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.24
References 1. Terasaka T, Kinoshita T, Kuno M, Seki N, Tanaka K, Nakanishi I.. (2004) Structure-based design, synthesis, and structure-activity relationship studies of novel non-nucleoside adenosine deaminase inhibitors., 47 (15): [PMID:15239652 ] [10.1021/jm0306374 ]