Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

4-(2-Acetyl-5-(benzo[c][1,2,5]thiadiazol-4-ylmethoxy)-phenoxy)-4-phenylbutanoic acid

ID: ALA3400989

PubChem CID: 73669820

Max Phase: Preclinical

Molecular Formula: C25H22N2O5S

Molecular Weight: 462.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc(OCc2ccc3nsnc3c2)cc1OC(CCC(=O)O)c1ccccc1

Standard InChI:  InChI=1S/C25H22N2O5S/c1-16(28)20-9-8-19(31-15-17-7-10-21-22(13-17)27-33-26-21)14-24(20)32-23(11-12-25(29)30)18-5-3-2-4-6-18/h2-10,13-14,23H,11-12,15H2,1H3,(H,29,30)

Standard InChI Key:  OBOOWVLIZKMMIV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -6.2443    5.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9402    5.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300    3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2240    2.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5281    3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5383    5.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8212    2.9576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8089    1.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1021    0.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5014    0.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4097    1.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7000    0.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6827   -0.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3750   -1.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0848   -0.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2091    1.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9015    0.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267    2.9927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3300    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0267    3.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2609    3.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5875    3.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0191    1.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8415    5.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8479    7.1636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8777    5.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8683    1.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8893   -0.4534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2982    0.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5858    1.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7010    0.5254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0937   -0.8491    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.6283   -0.6976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  9  1  0
 10 16  1  0
 16 17  1  0
  3 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 30  1  0
 29 23  1  0
 23 20  2  0
  6 24  1  0
 24 25  2  0
 24 26  1  0
 17 27  2  0
 17 28  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  1  0
 33 29  2  0
M  END

Associated Targets(non-human)

Ednrb Endothelin receptor ET-B (454 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ednra Endothelin receptor ET-A (1158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 462.53Molecular Weight (Monoisotopic): 462.1249AlogP: 5.46#Rotatable Bonds: 10
Polar Surface Area: 98.61Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.85CX Basic pKa: CX LogP: 4.87CX LogD: 1.63
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.57

References

1. Cai J, Liu L, Hong KH, Wang P, Li L, Cao M, Sun C, Wu X, Zong X, Chen J, Ji M..  (2015)  Discovery of phenoxybutanoic acid derivatives as potent endothelin antagonists with antihypertensive activity.,  23  (4): [PMID:25614116] [10.1016/j.bmc.2015.01.003]

Source