trans-cyclipostin P

ID: ALA3401162

PubChem CID: 118728275

Max Phase: Preclinical

Molecular Formula: C23H41O6P

Molecular Weight: 444.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCCO[P@]1(=O)OC[C@@H]2COC(=O)C2=C(C)O1

Standard InChI:  InChI=1S/C23H41O6P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27-30(25)28-19-21-18-26-23(24)22(21)20(2)29-30/h21H,3-19H2,1-2H3/t21-,30+/m0/s1

Standard InChI Key:  LXXPVFWDVXTYTB-URAOTHONSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
    0.0000   -1.3541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6754   -1.7673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3672    0.0000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3213    1.2853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7902    1.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8689   -0.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9378    0.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3608    0.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1640   -0.2295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2919   -1.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8040    1.1177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1967   -1.2138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1556    1.5498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9001   -2.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6458   -2.5696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5989   -2.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4915   -3.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8937   -5.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7863   -6.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1885   -7.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0811   -8.9634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4833  -10.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3759  -11.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7781  -12.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6707  -14.1298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0729  -15.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9655  -16.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3677  -18.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2603  -19.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6625  -20.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3762  -21.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  6  2  0
  1  3  1  0
  3  4  1  0
  7  5  1  0
  4  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
  3 11  2  0
  3 12  1  1
  7 13  1  6
  2 14  1  0
 10 15  2  0
 12 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3401162

    ---

Associated Targets(non-human)

Lipe Hormone-sensitive lipase (209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis H37Rv (422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 444.55Molecular Weight (Monoisotopic): 444.2641AlogP: 7.09#Rotatable Bonds: 16
Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.57CX LogD: 6.57
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.14Np Likeness Score: 0.46

References

1. Vasilieva E, Dutta S, Malla RK, Martin BP, Spilling CD, Dupureur CM..  (2015)  Rat hormone sensitive lipase inhibition by cyclipostins and their analogs.,  23  (5): [PMID:25678014] [10.1016/j.bmc.2015.01.028]
2. Cavalier JF, Spilling CD, Durand T, Camoin L, Canaan S..  (2021)  Lipolytic enzymes inhibitors: A new way for antibacterial drugs discovery.,  209  [PMID:33071055] [10.1016/j.ejmech.2020.112908]

Source