(1'S,6'R)-3'-(benzylsulfinyl)-7-chloro-4,6-dimethoxy-6'-methyl-3H-spiro[benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione

ID: ALA3402425

PubChem CID: 73053110

Max Phase: Preclinical

Molecular Formula: C23H21ClO6S

Molecular Weight: 460.94

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c2c(c1Cl)O[C@@]1(C=C([S+]([O-])Cc3ccccc3)C(=O)C[C@H]1C)C2=O

Standard InChI:  InChI=1S/C23H21ClO6S/c1-13-9-15(25)18(31(27)12-14-7-5-4-6-8-14)11-23(13)22(26)19-16(28-2)10-17(29-3)20(24)21(19)30-23/h4-8,10-11,13H,9,12H2,1-3H3/t13-,23-,31?/m1/s1

Standard InChI Key:  UPOACYJBVPQWIC-AIZHSPNTSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   11.2528   -8.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7475   -7.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4311  -13.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7740  -12.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0346   -9.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2192   -7.9123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8902  -11.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4555  -13.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5095  -12.9652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5042   -9.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1654  -11.1557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0043   -9.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8549  -11.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1202  -10.5655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0043   -9.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5071   -9.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9912  -13.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5267   -9.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5307  -11.6939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.3585  -14.0432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1826  -11.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9961   -7.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2378   -8.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7530   -8.6171    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2797  -10.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7516   -8.6055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3033  -12.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2488   -7.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3999  -11.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9345  -10.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7509   -7.9249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 22 28  2  0
  1 12  2  0
  8 20  1  0
  7 21  2  0
 29 21  1  0
 12 26  1  0
 25 18  1  0
  9  3  1  0
  2 22  1  0
  4  7  1  0
 18 16  1  0
 17  4  2  0
 13 29  1  0
 27 17  1  0
 14 25  1  0
 10  1  1  0
 24 10  1  0
 13 11  2  0
 15 24  1  0
 29 27  2  0
 23  6  2  0
 25 13  1  6
 21 14  1  0
 18 30  1  6
 26  2  2  0
 28  1  1  0
  7 19  1  0
 23 15  1  0
 16 23  1  0
 27  9  1  0
 15  5  2  0
  4  8  1  0
 25  5  1  0
 24 31  1  0
M  CHG  2  24   1  31  -1
M  END

Associated Targets(Human)

HCC1937 (423 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.94Molecular Weight (Monoisotopic): 460.0747AlogP: 4.11#Rotatable Bonds: 5
Polar Surface Area: 84.89Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.13CX LogD: 3.13
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: 0.85

References

1. Liéby-Muller F, Heudré Le Baliner Q, Grisoni S, Fournier E, Guilbaud N, Marion F..  (2015)  Synthesis and activities towards resistant cancer cells of sulfone and sulfoxide griseofulvin derivatives.,  25  (10): [PMID:25872984] [10.1016/j.bmcl.2015.03.081]

Source