(1'S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3'-(phenylsulfinyl)-3H-spiro[benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione

ID: ALA3402426

PubChem CID: 72737651

Max Phase: Preclinical

Molecular Formula: C22H19ClO6S

Molecular Weight: 446.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c2c(c1Cl)O[C@@]1(C=C([S+]([O-])c3ccccc3)C(=O)C[C@H]1C)C2=O

Standard InChI:  InChI=1S/C22H19ClO6S/c1-12-9-14(24)17(30(26)13-7-5-4-6-8-13)11-22(12)21(25)18-15(27-2)10-16(28-3)19(23)20(18)29-22/h4-8,10-12H,9H2,1-3H3/t12-,22-,30?/m1/s1

Standard InChI Key:  PYRLFNHMKOKIBV-BYGLIRNBSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.4281  -13.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7740  -12.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0337   -9.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2172   -7.9113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8904  -11.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4564  -13.3640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5065  -12.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5052   -9.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1620  -11.1590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8524  -11.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1193  -10.5680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0033   -9.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5041   -9.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9902  -13.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5237   -9.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5317  -11.6979    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.3593  -14.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1819  -11.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2358   -8.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7530   -8.6170    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2778  -10.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3014  -12.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3981  -11.7395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9308  -10.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7509   -7.9239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2550   -8.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0060   -9.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0072   -9.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2575  -10.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5065   -9.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 17  1  0
  5 18  2  0
 23 18  1  0
 21 15  1  0
  7  1  1  0
  2  5  1  0
 15 13  1  0
 14  2  2  0
 10 23  1  0
 22 14  1  0
 11 21  1  0
 20  8  1  0
 10  9  2  0
 12 20  1  0
 23 22  2  0
 19  4  2  0
 21 10  1  6
 18 11  1  0
 15 24  1  6
  5 16  1  0
 19 12  1  0
 13 19  1  0
 22  7  1  0
 12  3  2  0
  2  6  1  0
 21  3  1  0
 20 25  1  0
  8 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  8  1  0
M  CHG  2  20   1  25  -1
M  END

Associated Targets(Human)

HCC1937 (423 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.91Molecular Weight (Monoisotopic): 446.0591AlogP: 3.97#Rotatable Bonds: 4
Polar Surface Area: 84.89Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: 0.90

References

1. Liéby-Muller F, Heudré Le Baliner Q, Grisoni S, Fournier E, Guilbaud N, Marion F..  (2015)  Synthesis and activities towards resistant cancer cells of sulfone and sulfoxide griseofulvin derivatives.,  25  (10): [PMID:25872984] [10.1016/j.bmcl.2015.03.081]

Source