3-(6-Amino-purin-9-yl)-4-phenyl-butan-2-ol

ID: ALA341027

PubChem CID: 10016680

Max Phase: Preclinical

Molecular Formula: C15H17N5O

Molecular Weight: 283.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(O)C(Cc1ccccc1)n1cnc2c(N)ncnc21

Standard InChI:  InChI=1S/C15H17N5O/c1-10(21)12(7-11-5-3-2-4-6-11)20-9-19-13-14(16)17-8-18-15(13)20/h2-6,8-10,12,21H,7H2,1H3,(H2,16,17,18)

Standard InChI Key:  SSMBCMXVNGQHJG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    3.3042   -6.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -6.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3000   -4.9167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7792   -5.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5542   -7.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8042   -4.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -6.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875   -5.1667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0792   -5.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0042   -7.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3667   -7.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8042   -3.9375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1792   -7.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6250   -7.9875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9167   -6.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7667   -6.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7667   -8.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -8.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -6.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5292   -7.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  3  1  0
  8  2  1  0
  9 10  1  0
 10  8  2  0
 11  6  1  0
 12  6  1  0
 13  7  1  0
 14 11  1  0
 12 15  1  0
 16 12  1  0
 17 14  2  0
 18 14  1  0
 19 18  2  0
 20 17  1  0
 21 19  1  0
  3  4  1  0
  9  7  2  0
 21 20  2  0
M  END

Alternative Forms

Associated Targets(Human)

ADA Tclin Adenosine deaminase (129 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 283.33Molecular Weight (Monoisotopic): 283.1433AlogP: 1.57#Rotatable Bonds: 4
Polar Surface Area: 89.85Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.70CX LogP: 1.49CX LogD: 1.49
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.76Np Likeness Score: -0.27

References

1. Zhao YZ, van Breemen RB, Nikolic D, Huang CR, Woodbury CP, Schilling A, Venton DL..  (1997)  Screening solution-phase combinatorial libraries using pulsed ultrafiltration/electrospray mass spectrometry.,  40  (25): [PMID:9406591] [10.1021/jm960729b]

Source