The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1H-1,2,4-triazol-1-yl)chroman-4-one O-3,4-dichlorobenzyl oxime nitrate ID: ALA3415639
PubChem CID: 118733381
Max Phase: Preclinical
Molecular Formula: C18H15Cl2N5O5
Molecular Weight: 389.24
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Clc1ccc(CO/N=C2\c3ccccc3OCC2n2cncn2)cc1Cl.O=[N+]([O-])O
Standard InChI: InChI=1S/C18H14Cl2N4O2.HNO3/c19-14-6-5-12(7-15(14)20)8-26-23-18-13-3-1-2-4-17(13)25-9-16(18)24-11-21-10-22-24;2-1(3)4/h1-7,10-11,16H,8-9H2;(H,2,3,4)/b23-18+;
Standard InChI Key: SBRNHGNZOJUPMZ-XHMOQMQQSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
10.5704 2.3971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6098 2.9968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6098 4.1968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6493 2.3971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0328 2.9796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5005 3.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2485 1.9889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2430 0.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0018 3.7520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0049 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2929 6.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2920 7.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 8.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8900 7.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8910 6.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5925 5.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9307 5.4092 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.9289 8.1092 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
13 16 1 0
15 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
26 30 1 0
M CHG 2 1 -1 2 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.24Molecular Weight (Monoisotopic): 388.0494AlogP: 4.14#Rotatable Bonds: 4Polar Surface Area: 61.53Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.26CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.63Np Likeness Score: -0.99