The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-3-(1H-imidazol-1-yl)-2-methylchroman-4-one O-4-fluorobenzyl oxime nitrate ID: ALA3415641
PubChem CID: 118733384
Max Phase: Preclinical
Molecular Formula: C20H19FN4O5
Molecular Weight: 351.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1Oc2ccccc2/C(=N\OCc2ccc(F)cc2)[C@H]1n1ccnc1.O=[N+]([O-])O
Standard InChI: InChI=1S/C20H18FN3O2.HNO3/c1-14-20(24-11-10-22-13-24)19(17-4-2-3-5-18(17)26-14)23-25-12-15-6-8-16(21)9-7-15;2-1(3)4/h2-11,13-14,20H,12H2,1H3;(H,2,3,4)/b23-19+;/t14-,20-;/m0./s1
Standard InChI Key: LUBDDTPUUHDPTG-NNNNQTNWSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
10.5704 2.3963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6098 2.9959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6098 4.1959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6493 2.3963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0328 2.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5005 3.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2485 1.9889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2430 0.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0018 3.7520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0049 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2929 6.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2920 7.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 8.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8900 7.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8910 6.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5925 5.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9289 8.1092 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
12 16 1 6
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 17 1 0
13 17 1 1
15 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
M CHG 2 1 -1 2 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 351.38Molecular Weight (Monoisotopic): 351.1383AlogP: 3.97#Rotatable Bonds: 4Polar Surface Area: 48.64Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.69CX LogP: 3.86CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.77