(2S,3R)-3-(1H-imidazol-1-yl)-2-methylchroman-4-one O-4-fluorobenzyl oxime nitrate

ID: ALA3415641

PubChem CID: 118733384

Max Phase: Preclinical

Molecular Formula: C20H19FN4O5

Molecular Weight: 351.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1Oc2ccccc2/C(=N\OCc2ccc(F)cc2)[C@H]1n1ccnc1.O=[N+]([O-])O

Standard InChI:  InChI=1S/C20H18FN3O2.HNO3/c1-14-20(24-11-10-22-13-24)19(17-4-2-3-5-18(17)26-14)23-25-12-15-6-8-16(21)9-7-15;2-1(3)4/h2-11,13-14,20H,12H2,1H3;(H,2,3,4)/b23-19+;/t14-,20-;/m0./s1

Standard InChI Key:  LUBDDTPUUHDPTG-NNNNQTNWSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   10.5704    2.3963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6098    2.9959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6098    4.1959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6493    2.3963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995    2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321   -1.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8926    1.4990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0328    2.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5005    3.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2485    1.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2430    0.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0018    3.7520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049    5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2929    6.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2920    7.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5905    8.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8900    7.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8910    6.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5925    5.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9289    8.1092    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 12 16  1  6
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 13 17  1  1
 15 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
M  CHG  2   1  -1   2   1
M  END

Associated Targets(non-human)

Nannizzia gypsea (2039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 351.38Molecular Weight (Monoisotopic): 351.1383AlogP: 3.97#Rotatable Bonds: 4
Polar Surface Area: 48.64Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.69CX LogP: 3.86CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.77

References

1. Emami S, Ghanbarimasir Z..  (2015)  Recent advances of chroman-4-one derivatives: synthetic approaches and bioactivities.,  93  [PMID:25743215] [10.1016/j.ejmech.2015.02.048]

Source