The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,5-dimethoxy-3-hexadecyl-1,4-benzoquinone ID: ALA3416351
PubChem CID: 117872651
Max Phase: Preclinical
Molecular Formula: C24H40O4
Molecular Weight: 392.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCCC1=C(OC)C(=O)C=C(OC)C1=O
Standard InChI: InChI=1S/C24H40O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)22(27-2)19-21(25)24(20)28-3/h19H,4-18H2,1-3H3
Standard InChI Key: AKNPAZKGOWWPLZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6109 7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 8.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9149 9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2157 10.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2188 11.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5196 12.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5227 14.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8235 14.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8266 16.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1274 17.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1305 18.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1706 19.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5955 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
1 6 1 0
4 7 2 0
1 8 2 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
3 9 1 0
25 26 1 0
5 25 1 0
27 28 1 0
2 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.58Molecular Weight (Monoisotopic): 392.2927AlogP: 6.44#Rotatable Bonds: 17Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.28CX LogD: 7.28Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.21Np Likeness Score: 1.36
References 1. Filosa R, Peduto A, Schaible AM, Krauth V, Weinigel C, Barz D, Petronzi C, Bruno F, Roviezzo F, Spaziano G, D'Agostino B, De Rosa M, Werz O.. (2015) Novel series of benzoquinones with high potency against 5-lipoxygenase in human polymorphonuclear leukocytes., 94 [PMID:25765759 ] [10.1016/j.ejmech.2015.02.042 ]