1-(4-Bromophenyl)-3-(4-nitrophenyl)-4-(1,3-diphenyl-4,5-dihydro-1H-pyrazol-5-yl)pyrazole

ID: ALA3416391

PubChem CID: 118734048

Max Phase: Preclinical

Molecular Formula: C30H22BrN5O2

Molecular Weight: 564.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc(-c2nn(-c3ccc(Br)cc3)cc2C2CC(c3ccccc3)=NN2c2ccccc2)cc1

Standard InChI:  InChI=1S/C30H22BrN5O2/c31-23-13-17-24(18-14-23)34-20-27(30(33-34)22-11-15-26(16-12-22)36(37)38)29-19-28(21-7-3-1-4-8-21)32-35(29)25-9-5-2-6-10-25/h1-18,20,29H,19H2

Standard InChI Key:  BFCNZZJVMUPHNM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -1.1534   -1.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4111   -3.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0338    0.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1553   -3.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2296    3.2925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3397   -1.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9886   -5.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7593    2.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6928    6.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8397   -1.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6544    4.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9445    1.9884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7006    5.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0331   -0.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2611    3.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8182    2.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1890   -2.9886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4164    1.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2568   -0.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3316   -5.7715    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -0.4653   -0.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8177   -3.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6669   -1.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5242    0.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6273   -2.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1560   -2.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5871    1.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4356    1.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511    0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8704    5.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3274   -5.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3431   -3.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3278    3.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9165    4.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7334   -4.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6527   -1.9158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2994   -0.9050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2050   -2.9811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 19 29  1  0
 17  6  2  0
 33 16  2  0
  1 32  2  0
  6 10  1  0
 28  3  2  0
 10 14  1  0
 28 33  1  0
 27 29  1  0
 22 35  1  0
 16 18  1  0
 10  4  2  0
 25 23  1  0
 25 17  1  0
 11 30  2  0
  7 31  1  0
 11 15  1  0
 34 13  1  0
 13  9  2  0
 12 29  1  0
  9 30  1  0
  6 19  1  0
  5  8  2  0
 31 20  1  0
 31  2  2  0
 32  4  1  0
 19 23  2  0
 21  1  1  0
 24  3  1  0
 12 28  1  0
 25 22  1  0
  8 27  1  0
  8 11  1  0
 35  7  2  0
 12  5  1  0
 18 24  2  0
 22 26  2  0
 14 21  2  0
 15 34  2  0
  2 26  1  0
 36 37  2  0
 36 38  1  0
  1 36  1  0
M  CHG  2  36   1  38  -1
M  END

Alternative Forms

  1. Parent:

    ALA3416391

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 564.44Molecular Weight (Monoisotopic): 563.0957AlogP: 7.57#Rotatable Bonds: 6
Polar Surface Area: 76.56Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.03CX LogP: 8.24CX LogD: 8.24
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.16Np Likeness Score: -1.56

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source