1,3-Di(4-methylphenyl)-4-(3-phenyl-4,5-dihydro-1H-pyrazol-5-yl)pyrazole

ID: ALA3416392

PubChem CID: 118734049

Max Phase: Preclinical

Molecular Formula: C26H24N4

Molecular Weight: 392.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nn(-c3ccc(C)cc3)cc2C2CC(c3ccccc3)=NN2)cc1

Standard InChI:  InChI=1S/C26H24N4/c1-18-8-12-21(13-9-18)26-23(17-30(29-26)22-14-10-19(2)11-15-22)25-16-24(27-28-25)20-6-4-3-5-7-20/h3-15,17,25,28H,16H2,1-2H3

Standard InChI Key:  UDISLSJOCHPJEZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7329    3.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5941    6.1549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6524    0.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4937    5.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0639    6.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9694    5.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9125    5.4395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9492    5.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8519    4.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4469    1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2337    3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1524    3.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6193    3.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5726    6.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4423    1.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3432    4.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1532    0.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6418    1.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 23  1  0
 15  5  2  0
  1 26  2  0
  5  9  1  0
  9 13  1  0
 22 23  1  0
 18 28  1  0
  9  3  2  0
 20 19  1  0
 20 15  1  0
 10 24  2  0
  6 25  1  0
 10 14  1  0
 27 12  1  0
 12  8  2  0
 11 23  1  0
  8 24  1  0
  5 16  1  0
  4  7  2  0
 25  2  2  0
 26  3  1  0
 16 19  2  0
 17  1  1  0
 20 18  1  0
  7 22  1  0
  7 10  1  0
 28  6  2  0
 11  4  1  0
 18 21  2  0
 13 17  2  0
 14 27  2  0
  2 21  1  0
  1 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3416392

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.51Molecular Weight (Monoisotopic): 392.2001AlogP: 5.59#Rotatable Bonds: 4
Polar Surface Area: 42.21Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.78CX LogP: 6.34CX LogD: 6.34
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.26

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source