1-(4-Bromophenyl)-3-(4-nitrophenyl)-4-(3-phenyl-4,5-dihydro-1H-pyrazol-5-yl)pyrazole

ID: ALA3416394

PubChem CID: 118734051

Max Phase: Preclinical

Molecular Formula: C24H18BrN5O2

Molecular Weight: 488.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc(-c2nn(-c3ccc(Br)cc3)cc2C2CC(c3ccccc3)=NN2)cc1

Standard InChI:  InChI=1S/C24H18BrN5O2/c25-18-8-12-19(13-9-18)29-15-21(23-14-22(26-27-23)16-4-2-1-3-5-16)24(28-29)17-6-10-20(11-7-17)30(31)32/h1-13,15,23,27H,14H2

Standard InChI Key:  KDOVKXDHKNBNMQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.2149   -3.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2122   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7464   -5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9219   -7.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6571   -0.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7545   -4.3760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1434   -1.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7132   -9.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8444  -10.0685    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -4.6827   -2.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4226    1.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0460    0.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1320   -6.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1873   -2.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7536   -5.2860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6377   -6.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6374   -3.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0286    0.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9233   -7.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0332   -3.5919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9313    1.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -9.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0432    3.5993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 27 14  2  0
  2 21  1  0
 24  4  1  0
 12 29  1  0
  6  4  2  0
  7 11  2  0
 16 28  2  0
 28 15  1  0
 20 17  2  0
 14  7  1  0
 25 12  2  0
 18 21  1  0
  8 27  1  0
 15 23  2  0
 23 11  1  0
 19  1  1  0
  5 17  1  0
  7 16  1  0
 22  6  1  0
 29 13  1  0
 14 18  1  0
 29  5  2  0
  9 24  2  0
 20 25  1  0
 22  2  1  0
  8 21  1  0
  2  3  2  0
 19  3  1  0
 19 20  1  0
 10 26  2  0
  1 22  2  0
  6 10  1  0
 26  9  1  0
 30 31  2  0
 30 32  1  0
  9 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

  1. Parent:

    ALA3416394

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 488.35Molecular Weight (Monoisotopic): 487.0644AlogP: 5.65#Rotatable Bonds: 5
Polar Surface Area: 85.35Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.91CX LogP: 6.02CX LogD: 6.02
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -1.54

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source