4-(1-Acetyl-3-phenyl-4,5-dihydro-1H-pyrazol-5-yl)-1,3-di-(4-methylphenyl)pyrazole

ID: ALA3416395

PubChem CID: 118734052

Max Phase: Preclinical

Molecular Formula: C28H26N4O

Molecular Weight: 434.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1N=C(c2ccccc2)CC1c1cn(-c2ccc(C)cc2)nc1-c1ccc(C)cc1

Standard InChI:  InChI=1S/C28H26N4O/c1-19-9-13-23(14-10-19)28-25(18-31(30-28)24-15-11-20(2)12-16-24)27-17-26(29-32(27)21(3)33)22-7-5-4-6-8-22/h4-16,18,27H,17H2,1-3H3

Standard InChI Key:  ZHNIRXUBWZXWBH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    1.2149   -3.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2122   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7464   -5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9219   -7.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2181   -0.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8982   -4.1720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7107   -0.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7132   -9.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4448   -1.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5611    2.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3896    0.7315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1320   -6.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9505   -1.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7536   -5.2860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6377   -6.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6374   -3.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3847    0.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9233   -7.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0305   -3.1882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0636    2.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -9.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0186   -5.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1023   -6.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1954   -6.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8444  -10.0685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 26 13  2  0
  2 20  1  0
 23  4  1  0
 12 28  1  0
  6  4  2  0
  7 11  2  0
 15 27  2  0
 27 14  1  0
 19 16  2  0
 13  7  1  0
 24 12  2  0
 17 20  1  0
  8 26  1  0
 14 22  2  0
 22 11  1  0
 18  1  1  0
  5 16  1  0
  7 15  1  0
 21  6  1  0
 13 17  1  0
 28  5  2  0
  9 23  2  0
 19 24  1  0
 21  2  1  0
  8 20  1  0
  2  3  2  0
 18  3  1  0
 18 19  1  0
 10 25  2  0
  1 21  2  0
  6 10  1  0
 25  9  1  0
  8 29  1  0
 29 30  2  0
 29 31  1  0
  9 32  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3416395

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2107AlogP: 5.85#Rotatable Bonds: 4
Polar Surface Area: 50.49Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.73CX LogP: 6.05CX LogD: 6.05
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.42

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source