1,3-Di(4-methylphenyl)-4-(3-phenyl-1-propanoyl-4,5-dihydro-1H-pyrazol-5-yl)pyrazole

ID: ALA3416398

PubChem CID: 118734055

Max Phase: Preclinical

Molecular Formula: C29H28N4O

Molecular Weight: 448.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)N1N=C(c2ccccc2)CC1c1cn(-c2ccc(C)cc2)nc1-c1ccc(C)cc1

Standard InChI:  InChI=1S/C29H28N4O/c1-4-28(34)33-27(18-26(30-33)22-8-6-5-7-9-22)25-19-32(24-16-12-21(3)13-17-24)31-29(25)23-14-10-20(2)11-15-23/h5-17,19,27H,4,18H2,1-3H3

Standard InChI Key:  TUUOENXQANNMBT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7537    5.2860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7486   12.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0442   13.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1056    6.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5256    5.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0345    7.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1543    7.5927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7554   11.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1738    8.8450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4538    8.0630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5823    4.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7384    2.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6265    6.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6817    4.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6387    6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0540   10.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1309    6.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1887    3.3342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3466   12.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0748    5.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3535   11.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0341    2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0387   14.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8398    7.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 28 15  1  0
 29  4  1  0
 31 29  2  0
 28  9  2  0
 30 20  2  0
  4  3  2  0
 16 27  1  0
 22 11  2  0
  5 19  1  0
  8 16  2  0
 22 25  1  0
  1  7  1  0
 13 24  1  0
 13 14  1  0
 30  8  1  0
 18 21  1  0
  6  9  1  0
 27 17  2  0
 24 12  2  0
  3 12  1  0
  5 30  1  0
  2 23  1  0
  7 26  1  0
  2 26  1  0
 19 26  1  0
 17 20  1  0
 15 18  2  0
 21  6  2  0
 19 10  2  0
 24 31  1  0
 23  1  2  0
  2 22  1  0
 13 10  1  0
 14  5  2  0
  1 28  1  0
 27 32  1  0
  4 33  1  0
 25 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3416398

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 448.57Molecular Weight (Monoisotopic): 448.2263AlogP: 6.24#Rotatable Bonds: 5
Polar Surface Area: 50.49Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.74CX LogP: 6.75CX LogD: 6.75
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.47

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source