1-(4-Bromophenyl)-3-(4-nitrophenyl)-4-(3-phenyl-1-propanoyl-4,5-dihydro-1H-pyrazol-5-yl)pyrazole

ID: ALA3416400

PubChem CID: 118734057

Max Phase: Preclinical

Molecular Formula: C27H22BrN5O3

Molecular Weight: 544.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)N1N=C(c2ccccc2)CC1c1cn(-c2ccc(Br)cc2)nc1-c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C27H22BrN5O3/c1-2-26(34)32-25(16-24(29-32)18-6-4-3-5-7-18)23-17-31(21-14-10-20(28)11-15-21)30-27(23)19-8-12-22(13-9-19)33(35)36/h3-15,17,25H,2,16H2,1H3

Standard InChI Key:  SOSJNHGLJNDCDG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    0.4195   12.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9864   12.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5870   13.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0728    5.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0862    7.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1078    9.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1139    6.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1355    7.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6265    6.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4538    8.0630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1738    8.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6660    4.3308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3246    4.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5501    5.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0540   10.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5831    8.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6514   10.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6377    6.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0345    7.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7536    5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1056    6.6039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2182   11.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5536    9.9230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1496   11.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7343    9.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5 18  2  0
 17  4  2  0
 33  2  2  0
 31 29  1  0
  3  1  2  0
 13 27  1  0
 24 33  1  0
 12 26  1  0
 23 21  1  0
 29 11  1  0
 29 10  2  0
 32 15  1  0
 31 20  1  0
 19 13  2  0
 25  8  2  0
 11  9  2  0
  2  3  1  0
 12 22  1  0
 12  7  1  0
 16 24  1  0
 22 17  1  0
  7 31  2  0
  5 23  1  0
 22 27  2  0
 16 30  1  0
 20 14  1  0
  4 19  1  0
 15 16  2  0
 24 28  2  0
 32 14  1  0
 30 14  1  0
 20 26  2  0
 19  6  1  0
 32  5  1  0
  8 10  1  0
  9 25  1  0
  1 28  1  0
 34 35  2  0
 34 36  1  0
 25 34  1  0
M  CHG  2  34   1  36  -1
M  END

Alternative Forms

  1. Parent:

    ALA3416400

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 544.41Molecular Weight (Monoisotopic): 543.0906AlogP: 6.30#Rotatable Bonds: 6
Polar Surface Area: 93.63Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 1.29CX LogP: 6.43CX LogD: 6.43
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -1.71

References

1. Bekhit AA, Hassan AM, Abd El Razik HA, El-Miligy MM, El-Agroudy EJ, Bekhit Ael-D..  (2015)  New heterocyclic hybrids of pyrazole and its bioisosteres: design, synthesis and biological evaluation as dual acting antimalarial-antileishmanial agents.,  94  [PMID:25768697] [10.1016/j.ejmech.2015.02.038]

Source