The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-Hydroxy-3-octadec-8-enylamino-propoxy)-chromen-2-one ID: ALA3416682
PubChem CID: 118734249
Max Phase: Preclinical
Molecular Formula: C30H47NO4
Molecular Weight: 485.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C/CCCCCCCCNCC(O)COc1cc(=O)oc2ccccc12
Standard InChI: InChI=1S/C30H47NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-31-24-26(32)25-34-29-23-30(33)35-28-21-18-17-20-27(28)29/h9-10,17-18,20-21,23,26,31-32H,2-8,11-16,19,22,24-25H2,1H3/b10-9+
Standard InChI Key: VPBBSELCFCVNNT-MDZDMXLPSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
-12.9053 23.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 7.5123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7433 14.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4527 12.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5395 5.8509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4586 10.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7491 12.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1622 9.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.4875 27.5253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6486 -1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0396 15.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.4922 26.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6148 21.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3301 17.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9111 21.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1958 25.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6206 19.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3243 18.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1681 8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2017 24.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0338 16.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29 28 1 0
31 27 1 0
6 23 2 0
32 24 1 0
19 15 2 0
2 30 1 0
20 22 1 0
18 10 1 0
16 35 1 0
1 31 1 0
19 6 1 0
26 33 1 0
24 25 2 0
21 29 2 0
5 12 1 0
3 16 1 0
28 20 1 0
22 1 1 0
4 18 1 0
13 11 1 0
23 7 1 0
11 5 1 0
7 26 2 0
7 8 1 0
23 34 1 0
30 13 1 0
8 32 2 0
17 14 1 0
27 17 1 0
25 26 1 0
12 3 1 0
35 21 1 0
19 33 1 0
10 2 1 0
18 9 1 0
34 4 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.71Molecular Weight (Monoisotopic): 485.3505AlogP: 7.16#Rotatable Bonds: 21Polar Surface Area: 71.70Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.96CX LogP: 7.33CX LogD: 4.86Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.11Np Likeness Score: 0.34
References 1. Misra S, Singh LK, Priyanka, Gupta J, Misra-Bhattacharya S, Katiyar D.. (2015) Synthesis and biological evaluation of 4-oxycoumarin derivatives as a new class of antifilarial agents., 94 [PMID:25768703 ] [10.1016/j.ejmech.2015.02.043 ]