4-(2-Hydroxy-3-octadec-8-enylamino-propoxy)-chromen-2-one

ID: ALA3416682

PubChem CID: 118734249

Max Phase: Preclinical

Molecular Formula: C30H47NO4

Molecular Weight: 485.71

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C/CCCCCCCCNCC(O)COc1cc(=O)oc2ccccc12

Standard InChI:  InChI=1S/C30H47NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-31-24-26(32)25-34-29-23-30(33)35-28-21-18-17-20-27(28)29/h9-10,17-18,20-21,23,26,31-32H,2-8,11-16,19,22,24-25H2,1H3/b10-9+

Standard InChI Key:  VPBBSELCFCVNNT-MDZDMXLPSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
  -12.9053   23.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8717    7.5123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7433   14.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5870    3.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4527   12.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5395    5.8509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8775    6.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4586   10.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7491   12.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1622    9.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.4875   27.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486   -1.3517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0396   15.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.4922   26.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5812    5.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6148   21.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3301   17.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9111   21.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.1958   25.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6206   19.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3243   18.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1681    8.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2017   24.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907    2.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0338   16.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 29 28  1  0
 31 27  1  0
  6 23  2  0
 32 24  1  0
 19 15  2  0
  2 30  1  0
 20 22  1  0
 18 10  1  0
 16 35  1  0
  1 31  1  0
 19  6  1  0
 26 33  1  0
 24 25  2  0
 21 29  2  0
  5 12  1  0
  3 16  1  0
 28 20  1  0
 22  1  1  0
  4 18  1  0
 13 11  1  0
 23  7  1  0
 11  5  1  0
  7 26  2  0
  7  8  1  0
 23 34  1  0
 30 13  1  0
  8 32  2  0
 17 14  1  0
 27 17  1  0
 25 26  1  0
 12  3  1  0
 35 21  1  0
 19 33  1  0
 10  2  1  0
 18  9  1  0
 34  4  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3416682

    ---

Associated Targets(non-human)

Brugia malayi (1377 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.71Molecular Weight (Monoisotopic): 485.3505AlogP: 7.16#Rotatable Bonds: 21
Polar Surface Area: 71.70Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.96CX LogP: 7.33CX LogD: 4.86
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.11Np Likeness Score: 0.34

References

1. Misra S, Singh LK, Priyanka, Gupta J, Misra-Bhattacharya S, Katiyar D..  (2015)  Synthesis and biological evaluation of 4-oxycoumarin derivatives as a new class of antifilarial agents.,  94  [PMID:25768703] [10.1016/j.ejmech.2015.02.043]

Source