The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4'-(Dimethylamino)-5-hydroxy-[1,1'-biphenyl]-3-yl)-4-(2-(2-ethoxyphenyl)hydrazono)-3-methyl-1H-pyrazol-5(4H)-one ID: ALA3417402
PubChem CID: 136934823
Max Phase: Preclinical
Molecular Formula: C26H27N5O3
Molecular Weight: 457.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccc(N(C)C)cc3)c2)N=C1C
Standard InChI: InChI=1S/C26H27N5O3/c1-5-34-24-9-7-6-8-23(24)27-28-25-17(2)29-31(26(25)33)21-14-19(15-22(32)16-21)18-10-12-20(13-11-18)30(3)4/h6-16,27,32H,5H2,1-4H3/b28-25-
Standard InChI Key: BPJKUWXILSKTLE-FVDSYPCUSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8437 3.7801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1478 1.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8154 4.6596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9334 5.8739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5432 7.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 3.7597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4879 4.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5327 3.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0353 7.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6475 8.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7677 9.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2757 9.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6635 8.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1703 8.3088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2918 9.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0979 9.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 8 1 0
4 8 1 0
12 13 2 0
10 14 1 0
11 15 2 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
2 18 1 0
21 24 1 0
24 25 1 0
24 26 1 0
17 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 17 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.53Molecular Weight (Monoisotopic): 457.2114AlogP: 4.71#Rotatable Bonds: 7Polar Surface Area: 89.76Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.49CX Basic pKa: 4.66CX LogP: 5.32CX LogD: 4.08Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -1.15
References 1. Stornaiuolo M, La Regina G, Passacantilli S, Grassia G, Coluccia A, La Pietra V, Giustiniano M, Cassese H, Di Maro S, Brancaccio D, Taliani S, Ialenti A, Silvestri R, Martini C, Novellino E, Marinelli L.. (2015) Structure-based lead optimization and biological evaluation of BAX direct activators as novel potential anticancer agents., 58 (5): [PMID:25668341 ] [10.1021/jm501123r ]