The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-dibromo-6-((2-nitrobenzamido)methyl)phenyl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoate ID: ALA3421669
PubChem CID: 118735092
Max Phase: Preclinical
Molecular Formula: C22H17Br2N3O7
Molecular Weight: 595.20
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCN1C(=O)C=CC1=O)Oc1c(Br)cc(Br)cc1CNC(=O)c1ccccc1[N+](=O)[O-]
Standard InChI: InChI=1S/C22H17Br2N3O7/c23-14-10-13(12-25-22(31)15-4-1-2-5-17(15)27(32)33)21(16(24)11-14)34-20(30)6-3-9-26-18(28)7-8-19(26)29/h1-2,4-5,7-8,10-11H,3,6,9,12H2,(H,25,31)
Standard InChI Key: GBSPCDOSPAOGOD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 -1.3500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5895 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5843 -7.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8808 -8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1824 -7.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1876 -6.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 -5.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5278 -5.8743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4978 -4.0692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.4525 1.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4523 0.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6978 -1.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2317 -0.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3324 -1.5395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.6991 2.5271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
3 8 1 0
1 9 1 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
19 21 1 0
18 19 1 0
7 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
31 32 2 0
28 33 2 0
12 34 2 0
M CHG 2 19 1 21 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.20Molecular Weight (Monoisotopic): 592.9433AlogP: 3.66#Rotatable Bonds: 9Polar Surface Area: 135.92Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.97CX Basic pKa: ┄CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -1.01
References 1. O'Brien KT, Noto JG, Nichols-O'Neill L, Perez LJ.. (2015) Potent Irreversible Inhibitors of LasR Quorum Sensing in Pseudomonas aeruginosa., 6 (2): [PMID:25699144 ] [10.1021/ml500459f ]