4-(6,7-Dimethoxy-quinazolin-4-yl)-piperazine-1-carboxylic acid thiophen-2-ylamide

ID: ALA342247

PubChem CID: 11143810

Max Phase: Preclinical

Molecular Formula: C19H21N5O3S

Molecular Weight: 399.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2ncnc(N3CCN(C(=O)Nc4cccs4)CC3)c2cc1OC

Standard InChI:  InChI=1S/C19H21N5O3S/c1-26-15-10-13-14(11-16(15)27-2)20-12-21-18(13)23-5-7-24(8-6-23)19(25)22-17-4-3-9-28-17/h3-4,9-12H,5-8H2,1-2H3,(H,22,25)

Standard InChI Key:  DQFSRVKDTGSZIZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    1.7667   -4.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4792   -3.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750   -0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1875   -0.2125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750   -1.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750   -3.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042   -0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7667   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -4.3292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -5.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -4.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -5.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9875   -1.4500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4875   -5.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2000   -5.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542   -0.2125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7625   -1.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -1.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7625   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1917   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -1.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -0.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3708   -3.9292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3750   -5.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1250   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0875   -5.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  3  1  0
  5 19  1  0
  6  2  1  0
  7  4  1  0
  8  1  1  0
  9  1  2  0
 10  2  2  0
 11  8  2  0
 12  9  1  0
 13 12  2  0
 14  7  1  0
 15  8  1  0
 16 15  2  0
 17  3  2  0
 18 20  1  0
 19 21  1  0
 20  6  1  0
 21  6  1  0
 22  7  2  0
 23 14  1  0
 24 22  1  0
 25 12  1  0
 26 13  1  0
 27 25  1  0
 28 26  1  0
 13 11  1  0
 10 16  1  0
  5 18  1  0
 24 23  2  0
M  END

Associated Targets(Human)

PDGFRB Tclin Platelet-derived growth factor receptor (507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.48Molecular Weight (Monoisotopic): 399.1365AlogP: 3.06#Rotatable Bonds: 4
Polar Surface Area: 79.82Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.71CX Basic pKa: 5.37CX LogP: 2.74CX LogD: 2.74
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: -1.76

References

1. Matsuno K, Nakajima T, Ichimura M, Giese NA, Yu JC, Lokker NA, Ushiki J, Ide S, Oda S, Nomoto Y..  (2002)  Potent and selective inhibitors of PDGF receptor phosphorylation. 2. Synthesis, structure activity relationship, improvement of aqueous solubility, and biological effects of 4-[4-(N-substituted (thio)carbamoyl)-1-piperazinyl]-6,7-dimethoxyquinazoline derivatives.,  45  (20): [PMID:12238930] [10.1021/jm0201114]

Source