(2S)-N-[4-[3-Cyano-1-[2-(dimethylamino)ethyl]indol-5-yl]oxyphenyl]pyrrolidine-2-carboxamide

ID: ALA3422671

PubChem CID: 118735785

Max Phase: Preclinical

Molecular Formula: C24H27N5O2

Molecular Weight: 417.51

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCn1cc(C#N)c2cc(Oc3ccc(NC(=O)[C@@H]4CCCN4)cc3)ccc21

Standard InChI:  InChI=1S/C24H27N5O2/c1-28(2)12-13-29-16-17(15-25)21-14-20(9-10-23(21)29)31-19-7-5-18(6-8-19)27-24(30)22-4-3-11-26-22/h5-10,14,16,22,26H,3-4,11-13H2,1-2H3,(H,27,30)/t22-/m0/s1

Standard InChI Key:  PCYHYEFBTFIIEK-QFIPXVFZSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1783    2.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5503    3.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.4919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267    2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9282    3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9331    5.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6365    5.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3350    5.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3301    3.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    7.4936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3399    8.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2998    7.6480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3417    9.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1310   10.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5992   12.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0992   12.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5581   10.6031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1277   -4.3539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3028   -4.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3299   -5.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  3  0
  1 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  1  0
 23 20  1  1
 20 21  2  0
  7 22  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 23 27  1  0
 22 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3422671

    ---

Associated Targets(Human)

PFKFB1 Tbio 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 (38 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PFKFB2 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 (38 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PFKFB3 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 (1469 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.51Molecular Weight (Monoisotopic): 417.2165AlogP: 3.56#Rotatable Bonds: 7
Polar Surface Area: 82.32Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.71CX Basic pKa: 9.64CX LogP: 3.03CX LogD: -0.76
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -1.37

References

1. Boyd S, Brookfield JL, Critchlow SE, Cumming IA, Curtis NJ, Debreczeni J, Degorce SL, Donald C, Evans NJ, Groombridge S, Hopcroft P, Jones NP, Kettle JG, Lamont S, Lewis HJ, MacFaull P, McLoughlin SB, Rigoreau LJ, Smith JM, St-Gallay S, Stock JK, Turnbull AP, Wheatley ER, Winter J, Wingfield J..  (2015)  Structure-Based Design of Potent and Selective Inhibitors of the Metabolic Kinase PFKFB3.,  58  (8): [PMID:25849762] [10.1021/acs.jmedchem.5b00352]

Source