3-Ethoxymethyl-2,5,9-trimethyl-furo[3,2-g]chromen-7-one

ID: ALA342694

PubChem CID: 10085383

Max Phase: Preclinical

Molecular Formula: C17H18O4

Molecular Weight: 286.33

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOCc1c(C)oc2c(C)c3oc(=O)cc(C)c3cc12

Standard InChI:  InChI=1S/C17H18O4/c1-5-19-8-14-11(4)20-17-10(3)16-12(7-13(14)17)9(2)6-15(18)21-16/h6-7H,5,8H2,1-4H3

Standard InChI Key:  ZLQIIWZSAPEUNQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    1.6292   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6292   -2.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -3.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -2.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -3.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1542   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1875   -2.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1875   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1500   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7125   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2292   -3.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8667   -2.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -4.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1000   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1875   -2.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2625   -1.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8500   -1.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2500   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  6  1  0
  4  2  1  0
  5  1  1  0
  6  1  2  0
  7  3  2  0
  8  5  1  0
  9  7  1  0
 10  3  1  0
 11  2  2  0
 12 10  1  0
 13 12  1  0
 14 12  2  0
 15  4  1  0
 16  6  1  0
 17  8  1  0
 18  9  1  0
 19 15  1  0
 20 19  1  0
 21 20  1  0
  4  8  2  0
 11  7  1  0
 13  9  2  0
M  END

Associated Targets(Human)

KCNA1 Tclin Voltage-gated potassium channel subunit Kv1.1 (248 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 286.33Molecular Weight (Monoisotopic): 286.1205AlogP: 4.00#Rotatable Bonds: 3
Polar Surface Area: 52.58Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.68Np Likeness Score: 0.04

References

1. Wulff H, Rauer H, Düring T, Hanselmann C, Ruff K, Wrisch A, Grissmer S, Hänsel W..  (1998)  Alkoxypsoralens, novel nonpeptide blockers of Shaker-type K+ channels: synthesis and photoreactivity.,  41  (23): [PMID:9804693] [10.1021/jm981032o]

Source