The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Benzyloxycarbonylamino-2-{4-[(2,4-diamino-pteridin-6-ylmethyl)-methyl-amino]-benzoylamino}-hexanoic acid tert-butyl ester ID: ALA342744
PubChem CID: 44362567
Max Phase: Preclinical
Molecular Formula: C33H41N9O5
Molecular Weight: 643.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCCNC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cc1
Standard InChI: InChI=1S/C33H41N9O5/c1-33(2,3)47-30(44)25(12-8-9-17-36-32(45)46-20-21-10-6-5-7-11-21)39-29(43)22-13-15-24(16-14-22)42(4)19-23-18-37-28-26(38-23)27(34)40-31(35)41-28/h5-7,10-11,13-16,18,25H,8-9,12,17,19-20H2,1-4H3,(H,36,45)(H,39,43)(H4,34,35,37,40,41)
Standard InChI Key: FFFZUWQOMXIVFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
0.9167 -7.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -8.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9542 -7.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9917 -7.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4167 -6.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9542 -7.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -6.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0917 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6417 -6.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5167 -7.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -6.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0792 -2.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 -7.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -7.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -5.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -6.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4917 -6.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -6.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0917 -5.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6417 -6.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5917 -2.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0167 -7.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3750 -6.2125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -5.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -6.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -6.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -7.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4542 -8.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -3.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1167 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6292 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -7.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1292 -5.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0500 -5.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0542 -6.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -5.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0875 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6250 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -4.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -4.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1375 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 -1.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 5 1 0
4 2 1 0
5 1 2 0
6 1 1 0
7 3 1 0
8 17 1 0
9 16 1 0
10 4 1 0
11 8 1 0
12 32 1 0
13 7 2 0
14 18 1 0
15 9 1 0
16 11 1 0
17 28 2 0
18 13 1 0
19 14 1 0
20 8 2 0
21 9 2 0
22 12 2 0
23 12 1 0
24 10 2 0
25 15 1 0
26 5 1 0
27 29 2 0
28 30 1 0
29 19 1 0
30 19 2 0
31 6 1 0
32 40 1 0
33 23 1 0
34 33 1 0
35 14 1 0
36 16 1 0
37 25 1 0
38 25 1 0
39 25 1 0
40 44 1 0
41 34 2 0
42 34 1 0
43 36 1 0
44 43 1 0
45 42 2 0
46 41 1 0
47 45 1 0
3 4 2 0
13 24 1 0
27 17 1 0
46 47 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 643.75Molecular Weight (Monoisotopic): 643.3231AlogP: 3.76#Rotatable Bonds: 13Polar Surface Area: 200.57Molecular Species: NEUTRALHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 3.00CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.12Np Likeness Score: -0.71
References 1. Kempton RJ, Black AM, Anstead GM, Kumar AA, Blankenship DT, Freisheim JH.. (1982) Lysine and ornithine analogues of methotrexate as inhibitors of dihydrofolate reductase., 25 (4): [PMID:7069726 ] [10.1021/jm00346a026 ]