N-[4-(3-Nitro-phenyl)-thiazol-2-yl]-benzenesulfonamide

ID: ALA343363

PubChem CID: 10393215

Max Phase: Preclinical

Molecular Formula: C15H11N3O4S2

Molecular Weight: 361.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cccc(-c2csc(NS(=O)(=O)c3ccccc3)n2)c1

Standard InChI:  InChI=1S/C15H11N3O4S2/c19-18(20)12-6-4-5-11(9-12)14-10-23-15(16-14)17-24(21,22)13-7-2-1-3-8-13/h1-10H,(H,16,17)

Standard InChI Key:  BCSTXMINPUJFLR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    6.9917   -0.5542    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.5792   -1.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7542   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -1.9500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0542   -4.1750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4875   -1.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -0.6125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4875   -0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0542   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7667   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042    0.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2667   -0.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7667   -2.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7125   -0.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -4.5875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7667   -4.5875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -2.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0542   -1.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4250   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7125   -1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4250   -2.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1417   -0.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1417   -1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  9  1  0
  6  4  1  0
  7  3  1  0
  8  7  1  0
  9 13  2  0
 10  6  1  0
 11  1  2  0
 12  1  2  0
 13 10  1  0
 14  1  1  0
 15  5  1  0
 16  5  2  0
 17 19  2  0
 18 10  2  0
 19 18  1  0
 20 14  1  0
 21 14  2  0
 22 21  1  0
 23 20  2  0
 24 22  2  0
 24 23  1  0
  8  6  2  0
  9 17  1  0
M  CHG  2   5   1  15  -1
M  END

Alternative Forms

Associated Targets(non-human)

Kmo Kynurenine 3-monooxygenase (207 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 361.40Molecular Weight (Monoisotopic): 361.0191AlogP: 3.52#Rotatable Bonds: 5
Polar Surface Area: 102.20Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.74CX Basic pKa: CX LogP: 3.78CX LogD: 3.21
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.55Np Likeness Score: -2.30

References

1. Röver S, Cesura AM, Huguenin P, Kettler R, Szente A..  (1997)  Synthesis and biochemical evaluation of N-(4-phenylthiazol-2-yl)benzenesulfonamides as high-affinity inhibitors of kynurenine 3-hydroxylase.,  40  (26): [PMID:9435907] [10.1021/jm970467t]

Source