1-[5-Benzyloxy-2-(2-hydroxy-3-piperidin-1-yl-propoxy)-phenyl]-3-phenyl-propan-1-one

ID: ALA343400

PubChem CID: 10005083

Max Phase: Preclinical

Molecular Formula: C30H35NO4

Molecular Weight: 473.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccccc1)c1cc(OCc2ccccc2)ccc1OCC(O)CN1CCCCC1

Standard InChI:  InChI=1S/C30H35NO4/c32-26(21-31-18-8-3-9-19-31)23-35-30-17-15-27(34-22-25-12-6-2-7-13-25)20-28(30)29(33)16-14-24-10-4-1-5-11-24/h1-2,4-7,10-13,15,17,20,26,32H,3,8-9,14,16,18-19,21-23H2

Standard InChI Key:  YRJZDYAKHCFJLP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.4042   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4042   -2.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -1.8125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3125   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -1.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -3.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1167   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3125   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -3.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8292   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4000   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0250   -2.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4583   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -0.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4000   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1708   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1708   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8833   -3.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3208   -5.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -5.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4000   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6875   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5958   -3.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3208   -6.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1125   -6.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8833   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3917   -7.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4000   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6000   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  9  1  0
  5  1  2  0
  6  3  1  0
  7  2  2  0
  8  2  1  0
  9 13  1  0
 10  3  2  0
 11  5  1  0
 12 11  1  0
 13 14  1  0
 14  6  1  0
 15  8  1  0
 16 11  2  0
 17 12  1  0
 18 13  1  0
 19 15  1  0
 20 17  1  0
 21  4  1  0
 22  4  1  0
 23 20  1  0
 24 20  2  0
 25 19  2  0
 26 19  1  0
 27 22  1  0
 28 21  1  0
 29 24  1  0
 30 25  1  0
 31 26  2  0
 32 23  2  0
 33 31  1  0
 34 27  1  0
 35 29  2  0
 10 16  1  0
 30 33  2  0
 32 35  1  0
 28 34  1  0
M  END

Associated Targets(Human)

CCRF-CEM/VCR-1000 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.61Molecular Weight (Monoisotopic): 473.2566AlogP: 5.31#Rotatable Bonds: 12
Polar Surface Area: 59.00Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.01CX LogP: 5.46CX LogD: 4.75
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.63

References

1. Fleischer R, Wiese M..  (2003)  Three-dimensional quantitative structure-activity relationship analysis of propafenone-type multidrug resistance modulators: influence of variable selection on test set predictivity.,  46  (23): [PMID:14584949] [10.1021/jm030876r]
2. Kaiser D, Terfloth L, Kopp S, Schulz J, de Laet R, Chiba P, Ecker GF, Gasteiger J..  (2007)  Self-organizing maps for identification of new inhibitors of P-glycoprotein.,  50  (7): [PMID:17352460] [10.1021/jm060604z]

Source