Thieno[2,3-b]pyrrolizin-8-one O-(2-dimethylamino-ethyl)-oxime

ID: ALA344248

PubChem CID: 44360711

Max Phase: Preclinical

Molecular Formula: C13H15N3OS

Molecular Weight: 261.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCO/N=C1\c2sccc2-n2cccc21

Standard InChI:  InChI=1S/C13H15N3OS/c1-15(2)7-8-17-14-12-10-4-3-6-16(10)11-5-9-18-13(11)12/h3-6,9H,7-8H2,1-2H3/b14-12-

Standard InChI Key:  BLLXLUVDRGHQHD-OWBHPGMISA-N

Molfile:  

     RDKit          2D

 18 20  0  0  0  0  0  0  0  0999 V2000
    4.0250   -2.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -2.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2917   -0.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7792   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0667   -1.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -2.9417    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9792   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6667   -2.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3292   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5792   -0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9292   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292    0.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2500   -3.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3125   -3.8917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0750   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4875   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042   -3.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9667   -4.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  2  2  0
  5  1  1  0
  6  2  1  0
  7  4  1  0
  8  1  2  0
  9  3  1  0
 10  5  2  0
 11  6  1  0
 12 10  1  0
 13  8  1  0
 14 16  1  0
 15 13  1  0
 16 15  1  0
 17 14  1  0
 18 14  1  0
  4  3  1  0
  9 12  2  0
 11  7  2  0
M  END

Associated Targets(Human)

HTR3A Tclin Serotonin 3 (5-HT3) receptor (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 261.35Molecular Weight (Monoisotopic): 261.0936AlogP: 2.18#Rotatable Bonds: 4
Polar Surface Area: 29.76Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.82CX LogP: 2.66CX LogD: 2.10
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.53Np Likeness Score: -1.43

References

1. Baglin I, Daveu C, Lancelot JC, Bureau R, Dauphin F, Pfeiffer B, Renard P, Delagrange P, Rault S..  (2001)  First tricyclic oximino derivatives as 5-HT3 ligands.,  11  (4): [PMID:11229746] [10.1016/s0960-894x(00)00691-0]

Source