N-Hydroxy-2-[4-(4-methyl-pentyl)-3-oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl]-acetamide

ID: ALA34538

PubChem CID: 44283368

Max Phase: Preclinical

Molecular Formula: C16H22N2O3S

Molecular Weight: 322.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)CCCN1C(=O)C(CC(=O)NO)Sc2ccccc21

Standard InChI:  InChI=1S/C16H22N2O3S/c1-11(2)6-5-9-18-12-7-3-4-8-13(12)22-14(16(18)20)10-15(19)17-21/h3-4,7-8,11,14,21H,5-6,9-10H2,1-2H3,(H,17,19)

Standard InChI Key:  JRVGHEGQBXYFBY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   -1.7708   -0.6125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0500   -0.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583    0.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7708    1.0458    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4833   -0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4833    0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3458    1.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750    0.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3333   -0.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3792   -0.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875    1.0500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7708   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8042    0.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2000   -0.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2000    1.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0625   -1.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3583   -3.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9125   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3708   -3.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9125    0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  6  1  0
  5  1  1  0
  6  5  1  0
  7  3  1  0
  8  7  1  0
  9  2  2  0
 10  8  2  0
 11  8  1  0
 12  1  1  0
 13 11  1  0
 14  5  2  0
 15  6  2  0
 16 12  1  0
 17 16  1  0
 18 17  1  0
 19 14  1  0
 20 18  1  0
 21 18  1  0
 22 19  2  0
  4  3  1  0
 22 15  1  0
M  END

Associated Targets(non-human)

def Peptide deformylase (54 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.43Molecular Weight (Monoisotopic): 322.1351AlogP: 2.83#Rotatable Bonds: 6
Polar Surface Area: 69.64Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.89CX Basic pKa: CX LogP: 2.27CX LogD: 2.25
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.62Np Likeness Score: -0.93

References

1. Molteni V, He X, Nabakka J, Yang K, Kreusch A, Gordon P, Bursulaya B, Warner I, Shin T, Biorac T, Ryder NS, Goldberg R, Doughty J, He Y..  (2004)  Identification of novel potent bicyclic peptide deformylase inhibitors.,  14  (6): [PMID:15006385] [10.1016/j.bmcl.2004.01.014]

Source