The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2,5-Difluoro-phenylcarbamoyl)-methyl]-3-oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl}-N-hydroxy-acetamide ID: ALA34553
PubChem CID: 44283079
Max Phase: Preclinical
Molecular Formula: C18H15F2N3O4S
Molecular Weight: 407.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC1Sc2ccccc2N(CC(=O)Nc2cc(F)ccc2F)C1=O)NO
Standard InChI: InChI=1S/C18H15F2N3O4S/c19-10-5-6-11(20)12(7-10)21-17(25)9-23-13-3-1-2-4-14(13)28-15(18(23)26)8-16(24)22-27/h1-7,15,27H,8-9H2,(H,21,25)(H,22,24)
Standard InChI Key: HBZIXPDNOUXAQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-0.7958 -0.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 1.3000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.5083 0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5125 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6292 1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8125 -2.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0958 -1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 -2.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8000 -1.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 0.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8208 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6375 -0.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6250 -1.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3500 0.0708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0542 1.3083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2458 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5333 -4.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5333 -1.5875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.2500 -3.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5375 -4.8875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 0.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2333 -0.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2333 1.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9458 0.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9458 0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 6 1 0
5 1 1 0
6 5 1 0
7 3 1 0
8 10 1 0
9 11 1 0
10 9 1 0
11 1 1 0
12 7 1 0
13 8 1 0
14 2 2 0
15 8 2 0
16 9 2 0
17 12 2 0
18 12 1 0
19 15 1 0
20 13 2 0
21 15 1 0
22 19 2 0
23 20 1 0
24 18 1 0
25 5 2 0
26 6 2 0
27 25 1 0
28 27 2 0
4 3 1 0
28 26 1 0
22 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.40Molecular Weight (Monoisotopic): 407.0751AlogP: 2.31#Rotatable Bonds: 5Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.89CX Basic pKa: ┄CX LogP: 1.41CX LogD: 1.39Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -1.97
References 1. Molteni V, He X, Nabakka J, Yang K, Kreusch A, Gordon P, Bursulaya B, Warner I, Shin T, Biorac T, Ryder NS, Goldberg R, Doughty J, He Y.. (2004) Identification of novel potent bicyclic peptide deformylase inhibitors., 14 (6): [PMID:15006385 ] [10.1016/j.bmcl.2004.01.014 ]