The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{3-[2-(2,4-Difluoro-phenoxymethyl)-3-methyl-benzofuran-4-yloxy]-propyl}-pyridin-3-ylmethyl-amine ID: ALA345893
PubChem CID: 491350
Max Phase: Preclinical
Molecular Formula: C25H24F2N2O3
Molecular Weight: 438.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(COc2ccc(F)cc2F)oc2cccc(OCCCNCc3cccnc3)c12
Standard InChI: InChI=1S/C25H24F2N2O3/c1-17-24(16-31-21-9-8-19(26)13-20(21)27)32-23-7-2-6-22(25(17)23)30-12-4-11-29-15-18-5-3-10-28-14-18/h2-3,5-10,13-14,29H,4,11-12,15-16H2,1H3
Standard InChI Key: CBKBXWFRVHPWBU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
6.0042 -7.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -6.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 -6.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -7.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -7.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4875 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -8.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -7.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0750 -7.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -6.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2500 -7.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0042 -4.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4750 -7.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7167 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -4.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9000 -9.0917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3000 -7.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1542 -4.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7292 -5.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -7.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 -7.7875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0125 -5.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -3.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -4.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -7.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -6.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0042 -5.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 -3.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 -5.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -5.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2917 -5.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 4 1 0
6 9 2 0
7 6 1 0
8 1 1 0
9 11 1 0
10 3 2 0
11 8 1 0
12 23 2 0
13 9 1 0
14 17 1 0
15 25 1 0
16 6 1 0
17 13 2 0
18 29 1 0
19 2 1 0
20 5 2 0
21 14 1 0
22 10 1 0
23 15 1 0
24 30 1 0
25 18 1 0
26 20 1 0
27 10 1 0
28 32 2 0
29 24 1 0
30 22 1 0
31 15 2 0
32 31 1 0
5 3 1 0
26 27 2 0
14 7 2 0
28 12 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.47Molecular Weight (Monoisotopic): 438.1755AlogP: 5.55#Rotatable Bonds: 10Polar Surface Area: 56.52Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.80CX LogP: 4.46CX LogD: 3.05Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.08
References 1. Ebiike H, Masubuchi M, Liu P, Kawasaki K, Morikami K, Sogabe S, Hayase M, Fujii T, Sakata K, Shindoh H, Shiratori Y, Aoki Y, Ohtsuka T, Shimma N.. (2002) Design and synthesis of novel benzofurans as a new class of antifungal agents targeting fungal N-myristoyltransferase. Part 2., 12 (4): [PMID:11844682 ] [10.1016/s0960-894x(01)00808-3 ]