The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl 4-[3-[4-isopropyloxycarbonylanilino(thioxo)methylamino]anilino(thioxo)methylamino]benzoate ID: ALA345927
PubChem CID: 44373316
Max Phase: Preclinical
Molecular Formula: C28H30N4O4S2
Molecular Weight: 550.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)c1ccc(/N=C(\S)Nc2cccc(/N=C(/S)Nc3ccc(C(=O)OC(C)C)cc3)c2)cc1
Standard InChI: InChI=1S/C28H30N4O4S2/c1-17(2)35-25(33)19-8-12-21(13-9-19)29-27(37)31-23-6-5-7-24(16-23)32-28(38)30-22-14-10-20(11-15-22)26(34)36-18(3)4/h5-18H,1-4H3,(H2,29,31,37)(H2,30,32,38)
Standard InChI Key: FOQMBRUGXCINKO-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
2.1875 -0.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6167 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1917 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -1.0375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9042 -3.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3375 -3.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 -1.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4667 0.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9042 -2.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1792 0.2000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6167 -2.2750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0375 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4792 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 1.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1875 -1.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1917 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4750 -1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7542 -1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4792 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6167 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -2.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3292 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 0.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7667 -3.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1792 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6167 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7625 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4750 -3.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7625 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8917 0.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6167 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1792 1.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3292 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 13 1 0
4 14 1 0
5 1 2 0
6 18 1 0
7 2 2 0
8 1 1 0
9 3 1 0
10 4 1 0
11 1 1 0
12 2 1 0
13 23 2 0
14 22 2 0
15 3 2 0
16 4 2 0
17 19 2 0
18 17 1 0
19 5 1 0
20 26 2 0
21 27 2 0
22 29 1 0
23 28 1 0
24 8 1 0
25 7 1 0
26 25 1 0
27 24 1 0
28 24 2 0
29 25 2 0
30 9 1 0
31 10 1 0
32 34 2 0
33 32 1 0
34 19 1 0
35 30 1 0
36 31 1 0
37 30 1 0
38 31 1 0
13 21 1 0
18 33 2 0
14 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.71Molecular Weight (Monoisotopic): 550.1708AlogP: 6.88#Rotatable Bonds: 8Polar Surface Area: 101.38Molecular Species: ZWITTERIONHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.57CX Basic pKa: 13.77CX LogP: 9.61CX LogD: 8.94Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.11Np Likeness Score: -0.87
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]