Diethyl-{2-[1-(3-methyl-pyridin-2-yl)-1,4,5,6-tetrahydro-cyclopentaimidazole-2-sulfinylmethyl]-phenyl}-amine

ID: ALA347648

PubChem CID: 10692835

Max Phase: Preclinical

Molecular Formula: C23H28N4OS

Molecular Weight: 408.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)c1ccccc1C[S+]([O-])c1nc2c(n1-c1ncccc1C)CCC2

Standard InChI:  InChI=1S/C23H28N4OS/c1-4-26(5-2)20-13-7-6-11-18(20)16-29(28)23-25-19-12-8-14-21(19)27(23)22-17(3)10-9-15-24-22/h6-7,9-11,13,15H,4-5,8,12,14,16H2,1-3H3

Standard InChI Key:  FBHPTKWZMCNXPK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    5.8667   -3.0511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1244   -3.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2208   -4.2072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4837   -3.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4157   -2.9891    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.9863   -2.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0212   -4.3725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7136   -4.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7130   -3.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0065   -4.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3526   -1.7321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4094   -2.1659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3046   -4.2263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7463   -1.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3656   -3.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6160   -5.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4246   -4.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4471   -4.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0103   -5.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4721   -0.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6054   -4.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2939   -3.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3866   -2.4464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8589   -1.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5873   -3.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8944   -4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2242   -0.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4354   -5.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7282   -5.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  2  1  0
  6  1  1  0
  7  4  2  0
  8  9  1  0
  9  5  1  0
 10  8  1  0
 11  6  2  0
 12  5  1  0
 13 10  1  0
 14  6  1  0
 15  4  1  0
 16  7  1  0
 17  8  2  0
 18 15  1  0
 19 10  2  0
 20 11  1  0
 21 13  1  0
 22 13  1  0
 23 14  1  0
 24 14  2  0
 25 22  1  0
 26 21  1  0
 27 24  1  0
 28 17  1  0
 29 28  2  0
  3  7  1  0
 16 18  1  0
 27 20  2  0
 29 19  1  0
M  CHG  2   5   1  12  -1
M  END

Associated Targets(non-human)

Atp4a Potassium-transporting ATPase (425 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ATP4B Potassium-transporting ATPase (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 408.57Molecular Weight (Monoisotopic): 408.1984AlogP: 4.22#Rotatable Bonds: 7
Polar Surface Area: 57.01Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.44CX LogP: 4.39CX LogD: 4.39
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.18

References

1. Yamada M, Yura T, Morimoto M, Harada T, Yamada K, Honma Y, Kinoshita M, Sugiura M..  (1996)  2-[(2-Aminobenzyl)sulfinyl]-1-(2-pyridyl)-1,4,5,6-tetrahydrocyclopent[d]imidazoles as a novel class of gastric H+/K+-ATPase inhibitors.,  39  (2): [PMID:8558532] [10.1021/jm950610n]

Source