The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Methyl-4-oxo-4,5-dihydro-3H-pyrazolo[4,3-d][1,2,3]triazine-7-carboxylic acid methylamide ID: ALA34872
PubChem CID: 49796082
Max Phase: Preclinical
Molecular Formula: C16H32Cl3N9O2
Molecular Weight: 379.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.Cl.Cn1nnc2c(C(=O)NCCCN(CCCN)CCCCN)ncn2c1=O
Standard InChI: InChI=1S/C16H29N9O2.3ClH/c1-23-16(27)25-12-20-13(14(25)21-22-23)15(26)19-8-5-11-24(10-4-7-18)9-3-2-6-17;;;/h12H,2-11,17-18H2,1H3,(H,19,26);3*1H
Standard InChI Key: MJIAKHRLLKPFFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 28 0 0 0 0 0 0 0 0999 V2000
1.7167 -6.8917 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.2750 -3.1500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7542 -2.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9792 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0417 -1.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8625 -1.6125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3792 -2.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0292 -3.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8292 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -2.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6042 -3.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -2.4542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3292 -1.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5292 0.1583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7917 -5.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -2.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1917 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0375 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4542 -2.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1167 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -2.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4500 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6250 -3.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -5.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2917 -3.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2125 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7208 0.1958 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.6542 -2.8667 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 2 0
5 3 1 0
6 2 1 0
7 8 1 0
8 6 1 0
9 10 2 0
10 2 1 0
11 4 1 0
12 6 2 0
13 20 1 0
14 11 2 0
15 23 1 0
16 25 1 0
17 11 1 0
18 8 1 0
19 13 1 0
20 22 1 0
21 19 1 0
22 26 1 0
23 21 1 0
24 13 1 0
25 28 1 0
26 17 1 0
27 24 1 0
28 27 1 0
9 4 1 0
5 7 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.47Molecular Weight (Monoisotopic): 379.2444AlogP: -1.67#Rotatable Bonds: 12Polar Surface Area: 149.46Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.10CX Basic pKa: 10.42CX LogP: -1.32CX LogD: -6.77Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.37Np Likeness Score: -1.19
References 1. Clark AS, Deans B, Stevens MF, Tisdale MJ, Wheelhouse RT, Denny BJ, Hartley JA.. (1995) Antitumor imidazotetrazines. 32. Synthesis of novel imidazotetrazinones and related bicyclic heterocycles to probe the mode of action of the antitumor drug temozolomide., 38 (9): [PMID:7739008 ] [10.1021/jm00009a010 ]