(Z)-6-[(1R,2S,5S)-2-Azepan-1-yl-5-(3'-hydroxymethyl-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA349187

PubChem CID: 44374516

Max Phase: Preclinical

Molecular Formula: C31H41NO5

Molecular Weight: 507.67

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(O)CC/C=C\CO[C@H]1[C@@H](OCc2ccc(-c3cccc(CO)c3)cc2)CC[C@@H]1N1CCCCCC1

Standard InChI:  InChI=1S/C31H41NO5/c33-22-25-9-8-10-27(21-25)26-14-12-24(13-15-26)23-37-29-17-16-28(32-18-5-1-2-6-19-32)31(29)36-20-7-3-4-11-30(34)35/h3,7-10,12-15,21,28-29,31,33H,1-2,4-6,11,16-20,22-23H2,(H,34,35)/b7-3-/t28-,29-,31+/m0/s1

Standard InChI Key:  OHSXSRXQRFBCGG-FOKREPOFSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  1  0  0  0  0  0999 V2000
    1.3417   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1625   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9292   -3.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6375   -3.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3417   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7750   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -3.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833   -1.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9917   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -3.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7792   -2.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3625   -0.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3750   -1.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -2.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542   -2.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3167   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -0.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -3.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8042   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5542   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7000   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6625   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0292    0.5958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0000   -1.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8167   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2167   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4000   -4.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000   -5.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5000   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5  2  1  0
  6  7  1  0
  7 13  2  0
  8 30  1  0
  5  9  1  6
 10  6  1  0
 11  4  1  0
 12  8  2  0
 13 23  1  0
 14 22  2  0
 15 29  1  0
 16 15  2  0
  2 17  1  6
 18  9  1  0
 19 18  1  0
 20  8  1  0
 21 10  2  0
 22 19  1  0
 23 19  2  0
 24  3  1  0
 25  3  1  0
 26 32  1  0
 27  6  2  0
 28 27  1  0
 29 17  1  0
 30 31  1  0
 31 16  1  0
 32 21  1  0
 33 28  2  0
 34 24  1  0
 35 25  1  0
 36 34  1  0
 37 35  1  0
  5 11  1  0
 36 37  1  0
 14  7  1  0
 33 21  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA349187

   (Z)-6-[(1R,2S,5S)-2-(azepan-1-yl)-5-[[4-[3-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 507.67

Molecular Weight (Monoisotopic): 507.2985

AlogP: 5.58

#Rotatable Bonds: 12

Polar Surface Area: 79.23

Molecular Species: ZWITTERION

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.79

CX Basic pKa: 10.12

CX LogP: 2.54

CX LogD: 2.54

Aromatic Rings: 2

Heavy Atoms: 37

QED Weighted: 0.37

Np Likeness Score: 0.70

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  1  (12): [10.1016/S0960-894X(01)81049-0]

Source

Source(1):

• Scientific Literature