The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-6-[(1R,2S,5S)-2-Azepan-1-yl-5-(biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid ID: ALA350111
PubChem CID: 44374561
Max Phase: Preclinical
Molecular Formula: C30H39NO4
Molecular Weight: 477.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC/C=C\CO[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC[C@@H]1N1CCCCCC1
Standard InChI: InChI=1S/C30H39NO4/c32-29(33)13-7-4-10-22-34-30-27(31-20-8-1-2-9-21-31)18-19-28(30)35-23-24-14-16-26(17-15-24)25-11-5-3-6-12-25/h3-6,10-12,14-17,27-28,30H,1-2,7-9,13,18-23H2,(H,32,33)/b10-4-/t27-,28-,30+/m0/s1
Standard InChI Key: KMFPAIGKYNZRJV-SBQVCWCCSA-N
Molfile:
RDKit 2D
35 38 0 0 1 0 0 0 0 0999 V2000
1.3417 -3.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1625 -2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9292 -3.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6375 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3417 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 -1.6667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0167 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7792 -2.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5917 -0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3750 -1.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3625 -0.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -2.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -2.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9542 -2.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3167 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1417 -0.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -3.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5542 -1.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5417 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7000 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6625 -4.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5542 -2.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9917 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0000 -1.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1000 -5.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8167 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -0.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5000 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2167 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 -5.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 1
4 1 1 0
5 2 1 0
6 25 1 0
7 13 2 0
5 8 1 6
9 4 1 0
10 6 2 0
11 7 1 0
12 20 2 0
13 21 1 0
14 24 1 0
15 14 2 0
2 16 1 6
17 8 1 0
18 17 1 0
19 6 1 0
20 18 1 0
21 18 2 0
22 3 1 0
23 3 1 0
24 16 1 0
25 26 1 0
26 15 1 0
27 11 1 0
28 11 2 0
29 22 1 0
30 23 1 0
31 28 1 0
32 27 2 0
33 29 1 0
34 31 2 0
35 30 1 0
5 9 1 0
33 35 1 0
12 7 1 0
34 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.65Molecular Weight (Monoisotopic): 477.2879AlogP: 6.08#Rotatable Bonds: 11Polar Surface Area: 59.00Molecular Species: ZWITTERIONHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.79CX Basic pKa: 10.12CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 0.62
References 1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B. (1991) Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists, 1 (12): [10.1016/S0960-894X(01)81049-0 ]