(Z)-6-[(1R,2S)-2-Azepan-1-yl-5-(2'-hydroxy-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA350286

PubChem CID: 44374693

Max Phase: Preclinical

Molecular Formula: C30H39NO5

Molecular Weight: 493.64

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(O)CC/C=C\CO[C@H]1C(OCc2ccc(-c3ccccc3O)cc2)CC[C@@H]1N1CCCCCC1

Standard InChI:  InChI=1S/C30H39NO5/c32-27-11-6-5-10-25(27)24-15-13-23(14-16-24)22-36-28-18-17-26(31-19-7-1-2-8-20-31)30(28)35-21-9-3-4-12-29(33)34/h3,5-6,9-11,13-16,26,28,30,32H,1-2,4,7-8,12,17-22H2,(H,33,34)/b9-3-/t26-,28?,30+/m0/s1

Standard InChI Key:  XDBBQUBSMKTSDO-DNNNXZGLSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
    1.4667   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2875   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0542   -3.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7625   -3.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7167   -0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9000   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2417   -3.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0417   -1.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1417   -3.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9042   -2.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4875   -0.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -1.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3792   -2.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417   -2.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0792   -2.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4417   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2667   -0.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1417   -3.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6667   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792   -1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875    0.5458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8250   -3.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6667   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -1.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6792   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7417   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9292   -0.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2250   -5.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5250   -4.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3417   -0.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0417   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6250   -4.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5  7  1  0
  6  2  1  0
  7 14  1  0
  8 28  1  0
  9  6  1  0
 10  5  1  0
 11  4  1  0
 12  8  2  0
 13 21  1  0
 14 22  2  0
 15 26  1  0
 16 15  2  0
  2 17  1  6
 18  9  1  0
 19 18  1  0
 20  8  1  0
 21 19  2  0
 22 19  1  0
 23 10  1  0
 24  3  1  0
 25  3  1  0
 26 17  1  0
 27  5  2  0
 28 29  1  0
 29 16  1  0
 30 10  2  0
 31 24  1  0
 32 25  1  0
 33 27  1  0
 34 33  2  0
 35 31  1  0
 36 32  1  0
  6 11  1  0
 36 35  1  0
  7 13  2  0
 34 30  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA350286

   (Z)-6-[(1R,2S)-2-(azepan-1-yl)-5-[[4-(2-hydroxyphenyl)phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 493.64

Molecular Weight (Monoisotopic): 493.2828

AlogP: 5.79

#Rotatable Bonds: 11

Polar Surface Area: 79.23

Molecular Species: ZWITTERION

HBA: 5

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 3.79

CX Basic pKa: 10.26

CX LogP: 3.00

CX LogD: 3.00

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.39

Np Likeness Score: 0.79

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  1  (12): [10.1016/S0960-894X(01)81049-0]

Source

Source(1):

• Scientific Literature