The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((S)-1-Carboxy-2-phenyl-ethylcarbamoyl)-2-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyric acid ID: ALA352327
PubChem CID: 135405132
Max Phase: Preclinical
Molecular Formula: C34H33N5O7
Molecular Weight: 623.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](Cc2ccccc2)C(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C34H33N5O7/c1-3-17-39(20-23-9-14-27-26(18-23)32(42)36-21(2)35-27)25-12-10-24(11-13-25)31(41)38-28(33(43)44)15-16-30(40)37-29(34(45)46)19-22-7-5-4-6-8-22/h1,4-14,18,28-29H,15-17,19-20H2,2H3,(H,37,40)(H,38,41)(H,43,44)(H,45,46)(H,35,36,42)/t28-,29-/m0/s1
Standard InChI Key: FKYIVZFRSYLENF-VMPREFPWSA-N
Molfile:
RDKit 2D
46 49 0 0 1 0 0 0 0 0999 V2000
0.4417 -4.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1667 -5.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 -5.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4417 -6.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1667 -6.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 -6.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6042 -4.1042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7500 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5792 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3792 -2.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1792 -5.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -5.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -6.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3542 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0792 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -7.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -4.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7542 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4417 -4.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3167 -4.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -2.8667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -5.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4167 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9167 -1.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8792 -5.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6042 -3.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -3.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4667 -5.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2667 -3.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -6.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -2.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4292 -5.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6042 -6.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5875 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9958 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1250 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2167 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 -1.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2917 -0.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9250 -1.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 6 2 0
5 2 2 0
6 3 1 0
7 19 1 0
8 7 1 0
9 11 1 0
10 9 1 0
11 16 1 0
12 15 1 0
13 22 1 0
14 36 1 0
15 8 1 0
16 35 1 0
17 14 3 0
18 2 1 0
19 30 1 0
20 13 1 0
21 1 1 0
22 24 1 0
23 7 2 0
24 18 2 0
9 25 1 1
26 10 2 0
27 12 2 0
28 5 1 0
29 16 2 0
30 33 2 0
31 32 1 0
32 20 2 0
33 20 1 0
15 34 1 1
35 34 1 0
36 13 1 0
37 10 1 0
38 12 1 0
39 24 1 0
40 25 1 0
41 6 1 0
42 40 2 0
43 40 1 0
44 43 2 0
45 42 1 0
46 44 1 0
4 5 1 0
39 28 2 0
31 19 2 0
46 45 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.67Molecular Weight (Monoisotopic): 623.2380AlogP: 3.06#Rotatable Bonds: 14Polar Surface Area: 182.05Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.20CX Basic pKa: 1.75CX LogP: 4.06CX LogD: -2.46Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.13Np Likeness Score: -0.84
References 1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM.. (1996) Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583)., 39 (1): [PMID:8568829 ] [10.1021/jm950471+ ]