The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[2-(2-Amino-4-oxo-3,4,5,6,7,8-hexahydro-quinazolin-6-yl)-ethyl]-benzoylamino}-pentanedioic acid ID: ALA352444
PubChem CID: 136055863
Max Phase: Preclinical
Molecular Formula: C22H26N4O6
Molecular Weight: 442.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2c(n1)CCC(CCc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)C2
Standard InChI: InChI=1S/C22H26N4O6/c23-22-25-16-8-5-13(11-15(16)20(30)26-22)2-1-12-3-6-14(7-4-12)19(29)24-17(21(31)32)9-10-18(27)28/h3-4,6-7,13,17H,1-2,5,8-11H2,(H,24,29)(H,27,28)(H,31,32)(H3,23,25,26,30)
Standard InChI Key: TXHRVJYDANXEGJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-1.5958 -6.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0208 -6.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3083 -5.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6083 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3083 -7.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0208 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -4.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -5.1917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -4.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8833 -5.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -5.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3083 -5.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6917 -5.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8958 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -3.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7333 -7.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6917 -6.0250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -5.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -6.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -4.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9792 -4.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2667 -3.5417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -6.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -6.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4042 -4.7875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -6.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 -5.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -7.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 1 1 0
4 1 2 0
5 4 1 0
6 5 2 0
7 12 1 0
8 7 1 0
9 10 1 0
10 8 1 0
11 1 1 0
12 22 1 0
13 3 1 0
14 23 1 0
15 4 1 0
16 7 2 0
17 9 2 0
18 6 1 0
19 14 2 0
20 10 1 0
21 28 1 0
22 29 2 0
23 20 1 0
24 9 1 0
25 11 1 0
26 31 1 0
27 14 1 0
28 26 2 0
29 26 1 0
30 25 1 0
31 32 1 0
32 25 1 0
15 30 1 0
6 2 1 0
12 21 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.47Molecular Weight (Monoisotopic): 442.1852AlogP: 1.55#Rotatable Bonds: 9Polar Surface Area: 175.73Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.34CX Basic pKa: 2.89CX LogP: 2.25CX LogD: -3.93Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 0.02
References 1. Rosowsky A, Forsch RA, Moran RG.. (1989) (6R,6S)-5,8,10-trideaza-5,6,7,8-tetrahydrofolate and 6(R,6S)-5,8,10-trideaza-5,6,7,8-tetrahydropteroyl-L-ornithine as potential antifolates and antitumor agents., 32 (3): [PMID:2918520 ] [10.1021/jm00123a037 ]