The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(((1R)-1-(3-(2-(7-chloroquinolin-2-yl)vinyl)phenyl)-3-(2-(1,2-dihydroxypropan-2-yl)phenyl)propylthio)methyl)cyclopropyl)acetic acid ID: ALA3526481
Cas Number: 186352-97-6
PubChem CID: 9960377
Product Number: M356358, Order Now?
Max Phase: Preclinical
Molecular Formula: C35H36ClNO4S
Molecular Weight: 602.20
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(O)(CO)c1ccccc1CC[C@@H](SCC1(CC(=O)O)CC1)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1
Standard InChI: InChI=1S/C35H36ClNO4S/c1-34(41,22-38)30-8-3-2-6-25(30)12-16-32(42-23-35(17-18-35)21-33(39)40)27-7-4-5-24(19-27)9-14-29-15-11-26-10-13-28(36)20-31(26)37-29/h2-11,13-15,19-20,32,38,41H,12,16-18,21-23H2,1H3,(H,39,40)/b14-9+/t32-,34?/m1/s1
Standard InChI Key: UFQIEVSCRCMNLW-SHISVWIYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
12.5934 -4.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5955 -5.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8807 -6.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8788 -6.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5895 -7.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2981 -6.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3022 -6.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1700 -5.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4573 -6.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7465 -5.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0373 -6.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3241 -5.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6109 -6.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6109 -6.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3241 -7.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0373 -6.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9059 -5.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1927 -6.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7704 -6.0423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4836 -5.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4836 -4.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7704 -4.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0572 -4.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3439 -4.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6349 -4.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6349 -5.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3440 -6.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0572 -5.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9258 -6.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7449 -4.8037 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4597 -4.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4576 -3.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6548 -3.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1827 -2.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2681 -3.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5533 -2.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0280 -2.0337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3660 -2.5191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8805 -4.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3000 -4.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5880 -3.9910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0088 -4.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
8 9 1 0
9 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
19 28 1 0
23 28 1 0
26 29 1 0
18 20 1 0
13 17 1 0
10 11 1 0
30 31 1 0
32 33 1 0
33 34 1 0
32 34 1 0
36 37 2 0
36 38 1 0
35 36 1 0
32 35 1 0
31 32 1 0
10 30 1 6
3 8 1 0
1 2 1 0
1 39 1 0
1 40 1 0
1 41 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.20Molecular Weight (Monoisotopic): 601.2054AlogP: 7.92#Rotatable Bonds: 13Polar Surface Area: 90.65Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.40CX Basic pKa: 3.12CX LogP: 7.45CX LogD: 4.75Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.11
References 1. Filppula AM, Laitila J, Neuvonen PJ, Backman JT.. (2011) Reevaluation of the microsomal metabolism of montelukast: major contribution by CYP2C8 at clinically relevant concentrations., 39 (5): [PMID:21289076 ] [10.1124/dmd.110.037689 ]