The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-5-((R)-1-(carboxymethylamino)-1-oxo-3-(phenethylcarbamoylthio)propan-2-ylamino)-5-oxopentanoic acid ID: ALA3526822
PubChem CID: 118753165
Max Phase: Preclinical
Molecular Formula: C19H26N4O7S
Molecular Weight: 454.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)N[C@@H](CSC(=O)NCCc1ccccc1)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C19H26N4O7S/c20-13(18(28)29)6-7-15(24)23-14(17(27)22-10-16(25)26)11-31-19(30)21-9-8-12-4-2-1-3-5-12/h1-5,13-14H,6-11,20H2,(H,21,30)(H,22,27)(H,23,24)(H,25,26)(H,28,29)/t13-,14-/m0/s1
Standard InChI Key: QHWHFUJECZNPGN-KBPBESRZSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
8.5306 -13.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2432 -12.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8180 -12.8896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2507 -13.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1053 -13.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9642 -13.2981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3894 -13.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2432 -12.0604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2507 -14.1399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9633 -12.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1053 -14.1274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3935 -14.1148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6684 -12.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6801 -13.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3928 -12.8980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5298 -12.9022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9633 -12.0729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8180 -14.5399 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.1062 -12.8771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5306 -14.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8190 -15.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1048 -15.7785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5341 -15.7767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5350 -16.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2501 -17.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2511 -17.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5370 -18.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5376 -19.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2533 -19.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9697 -19.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9656 -18.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 6
4 10 1 0
5 3 1 0
6 2 1 0
7 13 1 0
8 2 2 0
9 4 2 0
10 14 1 0
11 5 2 0
12 7 2 0
13 6 1 0
14 15 1 0
15 5 1 0
16 4 1 0
10 17 1 1
18 20 1 0
19 7 1 0
20 1 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.51Molecular Weight (Monoisotopic): 454.1522AlogP: -0.45#Rotatable Bonds: 13Polar Surface Area: 187.92Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.75CX Basic pKa: 9.31CX LogP: -3.19CX LogD: -6.44Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.23Np Likeness Score: 0.20
References 1. Yoshigae Y, Sridar C, Kent UM, Hollenberg PF.. (2013) The inactivation of human CYP2E1 by phenethyl isothiocyanate, a naturally occurring chemopreventive agent, and its oxidative bioactivation., 41 (4): [PMID:23371965 ] [10.1124/dmd.112.050609 ]