The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
16-epiestriol-3-glucuronide ID: ALA3527099
PubChem CID: 118753251
Max Phase: Preclinical
Molecular Formula: C24H32O9
Molecular Weight: 464.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4ccc(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)cc4CC[C@H]3[C@@H]1C[C@H](O)[C@@H]2O
Standard InChI: InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(32-23-19(28)17(26)18(27)20(33-23)22(30)31)8-10(12)2-4-14(13)15(24)9-16(25)21(24)29/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/t13-,14-,15+,16+,17+,18+,19-,20+,21+,23-,24+/m1/s1
Standard InChI Key: UZKIAJMSMKLBQE-FFLBMIEMSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
11.2959 -23.0376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7423 -23.8408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7732 -25.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3524 -26.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6000 -24.2908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0713 -26.3512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3134 -23.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0366 -24.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0464 -25.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3406 -25.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6175 -25.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9061 -25.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5902 -20.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5820 -21.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8655 -21.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1533 -21.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4411 -21.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4327 -22.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8781 -20.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1575 -20.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8697 -22.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3650 -21.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7205 -21.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3775 -20.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1533 -23.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7288 -23.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8565 -20.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0082 -22.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0082 -21.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5820 -19.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6315 -19.5347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8572 -20.9758 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.1450 -22.2088 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.5820 -22.2129 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.6812 -20.9946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1916 -25.1279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 12 1 0
11 5 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 1
7 1 1 1
8 2 1 6
9 3 1 1
10 4 1 6
14 13 1 0
15 14 1 0
16 20 1 0
17 16 1 0
18 17 2 0
19 13 1 0
20 19 1 0
21 15 1 0
22 14 1 0
23 17 1 0
24 13 1 0
25 21 1 0
26 18 1 0
27 24 1 0
28 29 1 0
29 23 2 0
13 30 1 1
24 31 1 1
1 28 1 0
15 32 1 1
16 33 1 6
14 34 1 6
22 27 1 0
15 16 1 0
18 25 1 0
26 28 2 0
27 35 1 1
12 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.51Molecular Weight (Monoisotopic): 464.2046AlogP: 0.15#Rotatable Bonds: 3Polar Surface Area: 156.91Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.30CX Basic pKa: ┄CX LogP: 0.72CX LogD: -2.70Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: 2.20
References 1. Sneitz N, Vahermo M, Mosorin J, Laakkonen L, Poirier D, Finel M.. (2013) Regiospecificity and stereospecificity of human UDP-glucuronosyltransferases in the glucuronidation of estriol, 16-epiestriol, 17-epiestriol, and 13-epiestradiol., 41 (3): [PMID:23288867 ] [10.1124/dmd.112.049072 ]