The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-5-((R)-1-(carboxymethylamino)-1-oxo-3-(phenethylcarbamothioylthio)propan-2-ylamino)-5-oxopentanoic acid ID: ALA3527413
PubChem CID: 101164969
Max Phase: Preclinical
Molecular Formula: C19H26N4O6S2
Molecular Weight: 470.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)N[C@@H](CSC(=S)NCCc1ccccc1)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C19H26N4O6S2/c20-13(18(28)29)6-7-15(24)23-14(17(27)22-10-16(25)26)11-31-19(30)21-9-8-12-4-2-1-3-5-12/h1-5,13-14H,6-11,20H2,(H,21,30)(H,22,27)(H,23,24)(H,25,26)(H,28,29)/t13-,14-/m0/s1
Standard InChI Key: WSGBVCNCZSZCGE-KBPBESRZSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
28.7722 -5.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4848 -5.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0594 -5.4143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4915 -5.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3466 -5.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2059 -5.8227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6314 -5.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4848 -4.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4915 -6.6647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2043 -5.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3466 -6.6523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6356 -6.6397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9103 -5.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9211 -5.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6339 -5.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7705 -5.4269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2043 -4.5973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0594 -7.0649 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.3483 -5.4018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7722 -6.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0604 -7.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3462 -8.3036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.7756 -8.3019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7766 -9.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4918 -9.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4927 -10.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7785 -10.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7792 -11.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4949 -12.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2116 -11.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2073 -10.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 6
4 10 1 0
5 3 1 0
6 2 1 0
7 13 1 0
8 2 2 0
9 4 2 0
10 14 1 0
11 5 2 0
12 7 2 0
13 6 1 0
14 15 1 0
15 5 1 0
16 4 1 0
10 17 1 1
18 20 1 0
19 7 1 0
20 1 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.57Molecular Weight (Monoisotopic): 470.1294AlogP: -0.29#Rotatable Bonds: 13Polar Surface Area: 170.85Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.79CX Basic pKa: 9.31CX LogP: -2.25CX LogD: -5.68Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: 0.07
References 1. Yoshigae Y, Sridar C, Kent UM, Hollenberg PF.. (2013) The inactivation of human CYP2E1 by phenethyl isothiocyanate, a naturally occurring chemopreventive agent, and its oxidative bioactivation., 41 (4): [PMID:23371965 ] [10.1124/dmd.112.050609 ]